BLUEBOOK Compiler GEAS
BLUEBOOK Compiler GEAS
fAlgebra:
1. Find the geometric mean between -2 and -8.
A. 4 B. 16 C. -4* D. 6
!BackDOOR
Substitute ans: C
4. In a potato race, 8 potatoes are placed 6 feet apart on a straight line, the first being 6 ft
from the basket. A contestant starts from the basket and puts one potato at a time into the
basket. Find the total distance he must run in order to finish the race.
A. 532 ft. B. 432 ft* C. 342 ft D. 222 ft
5. Determine how much water should be evaporated from 50kg of 30% salt solution to
produce a 60% salt solution. All percentages are by weight.
A. 25 kg * B. 35 kg C. 15 kg D. 18 kg
Trigonometry:
6. Simplify the equation Sin2x(1+cot2x).
A. sin2x C. 1*
B. cos x
2
D. sec2xsin2x
7. The angle of elevation of the top of a tower from a point A is 2330 ' . From another point B,
the angle of elevation of the top of the tower is 5530 ' . The points A and B are 217.45 m
apart and on the same horizontal plane as the foot of the tower. The horizontal angle
subtended by A and B at the foot of the tower is 90 degrees. Find the height of the tower.
A. 90.6 m* C. 89.5 m
B. 86.7 m D. 55.9 m
X = 92.67816
8. In triangle ABC, angle A=80 deg. and point D is inside the triangle. If BD and CD are bisectors
of angle B and C, solve for the angle BDC.
A. 100 deg. C. 120 deg.
B. 130 deg.* D. 140 deg.
9. The sum of the sides of a triangle is equal to 100 cm. If the angles of the triangle are in the
continued proportions of 1:2:4. Compute the shortest side of the triangle.
A. 17.545 C. 18.525
B. 19.806* D. 14.507
Analytic Geometry:
11. The line segment connecting (x, 6) and (9, y) is bisected by the point (7, 3). Find the values
of x and y.
A. 14, 6 C. 5, 0*
B. 33, 12 D. 14, 6
Bisected is midpoint. Therefore, distance between point1 and (7,3) should be equal to distance
between (7,3) and point 2
12. The line 2x – 3y + 2 = 0 is perpendicular to another line L1 of unknown equation. Find the
slope of L1.
A. 3/2 C. 2/3
B. -3/2* D. -2/3
13. Two buildings in a shopping complex are shaped like a branches of the hyperbola
729x2−1024y2−746496=0 , where x and y are in feet. How far apart are the buildings at their
closest part?
A. 68 ft. apart C. 75 ft. apart
B. 64 ft. apart* D. 80 ft. apart
Let’s try this one without drawing it, since we know that the closest points of a hyperbola are
where the vertices are, and the buildings would be 2a feet apart.
By doing a little algebra (adding 746496 to both sides and then dividing all terms by 746496) we
see that the equation in hyperbolic form is x21024−y2729=1. So a= sqrt(1024) = 32. The
building are 32 x 2 = 64 feet apart at their closest part.
ME 601
14. An ice rink is in the shape of an ellipse, and is 150 feet long and 75 feet wide. What is the
width of the rink 15 feet from a vertex?
A. 50 ft. C. 60 ft.
B. 45 ft.* D. 40 ft.
Let’s first find the equation of the ellipse, with the center at (0,0). Since the major axis is 150,
and the minor axis is 75, we have a=75 and b=37.5. From this, we know the equation of the
ellipse is x2/752+ y2/37.52 = 1, or x2/5625 + y2/1406.25 = 1.
Now that we have the equation, we can plug in any x value to get the y value(s) on the ellipse;
since we want the width of the ellipse 15 feet from the vertex, our x value is 75 – 15 = 60.
Plugging in 60 for x, we get: 602/5625 + y2/1406.25 = 1; solving for y, we get ±√
[(1−602/5625)×1406.25]= ± 22.5 (take positive only). Note that we need to take double 22.5 to
get the whole width: the width of the rink 15 feet from a vertex is 45 feet
15. The sides of a quadrilateral are 10m, 8m, 16m and 20m, respectively. Two opposite interior
angles have a sum of 225°. Find the area of the quadrilateral in sq. m.
A. 140.33 sq. cm. C. 150.33 sq. cm.
B. 145.33 sq. cm.* D. 155.33 sq. cm.
RECALL: Plane Geometry (TRAPEZIUM FORMULA)
S = (10+8+16+20)/2 = 27 ; ∅ = 225/2 = 112.5
Then A = SQRT((27-10) (27-8) (27-16) (27-20)-
10*8*16*20*0.1464)
Cos2Angle = 0.1464
Area = 145.33
Differential Calculus:
16. For what values of x is the derivative of x3 equal to the derivative of x2 + x?
A. 1, -1/3 * C. -1, 1/3
B. 1.62, -0.62 D. -1.62, 0.62
Derivative of x3 = 3x2
x2 + x = 2x +1
Equate: 3x2 = 2x +1 ; 3x2 - 2x - 1 = 0
MODE: 5:3; Ans: x1 = 1 ; x2 = -1/3
ME 601
17. Find the angle between the two curves y=x2 and y = x3+x2+1 at their point of intersection.
A. 71.6* B. 45 C. 61.7 D. 54
Line 1 = x2
Line 2 = x3+x2+1
Solving the intersection of the 2 lines: (equate both eqns)
x2 = x3+x2+1 ; x3 + 1 = 0 ; x = 1
18. A military courier is located on a desert 6 miles from a point P which is the point on a long
straight road nearest to him. He is ordered to get to a point Q, 3 miles on the road.
Assuming that he can travel 14 miles per hour on the desert and 50 miles per hour on the
road, find the point where he should reach the road in order to get to Q in the least possible
time.
A. 2 mi B. 2.25 mi C.1.75 mi * D.1.5 mi
19. Find the point in the parabola y2 = 4x at which the rate of change of the ordinate and
abscissa are equal.
A. (1,0) B. (2,1) C. (1,2) * D. (1,1)
20. The dimensions of a rectangle are continuously changing. The length decreases at the rate
of 2 in/sec while the width increases at the rate of 3 in/sec. At one instant the rectangle is a
20 inch square. How fast is its area changing 3 seconds later?
A. 10 in2/sec C. 16 in2/sec*
B. 12 in2/sec D. 14 in2/sec
ME 601
Formula A = LW
Derive both side (recall product)
dA/dt = L(dw/dt) + w(dL/dt)
Integral Calculus:
21. Find the area bounded by the curve y=8-x3 and the x-axis.
A. 21 sq. units C. 12 sq. units*
B. 32 sq. units D. 18 sq. units
@x = 0
Y = 8 – x3
Y=8–0=8
@y = 0
0 = 8 - x3 ; x3 = 8; x = 2
t
Use calc
A = 12 sq. units
22. Given the area in the first quadrant bounded by x2=8y, the line x=4 and the x-axis. What is
the volume generated by revolving this area about the y-axis?
A. 50.265 cu. units C. 40.345 cu. units*
B. 32.561 cu. units D. 36.251 cu. Units
3x
2 y
23. Evaluate:
2
9y2 dxdy
0 0
A. 30 B. 50 C. 40 * D. 20
24. Find the length of arc of the curve y = e-x bounded by the coordinate axes and the line x = 5.
A. 4.97 B. 3.83 C. 5.23* D. 4.53
25. Find the surface area generated by rotating the first quadrant portion of the curve x2 = 16 –
8y about the x – axis.
A. 36.57* B. 61.27 C. 43.56 D. 39.77
f’(x) = 1/4(x)
t
Then, h = 36.574
ME 601
Differential Equation:
26. A tank initially contains 2500 liters of brine having 50 % salt in solution. Fresh water enters
the tank at the rate of 25 liters per minute and the resulting mixture leaves the tank at the
rate of 50 liters per minute. Find the percentage of salt in the tank at the end of 20 minutes.
a. 40 % * C. 10 %
b. 30 % D. 20 %
29. Find the equation of the curve that passes through (4, -2) and cuts at right angles every
curve of the family y2 =cx3 .
a. 2x2+3y2 = 44 * C. 3x2+2y2 = 22
b. 3y2 -2x2 = 44 D. 2x2-3y2 = 22
Using Calc: Substitute value of (4, -2), that satisfies the equation, on this case
2(4)2 + 3(-2)2 = 44. Ans is A
ME 601
Physics:
31. A 200 gram apple is thrown from the edge of a tall building with an initial speed of 20 m/s.
What is the change is kinetic energy of the apple if it strikes the ground at 50 m/s?
a. 100 joules b. 180 joules c. 81 joules d. 210 joules*
RECALL: Oscillatory motion Repeated back and forth movement over the same path about an
equilibrium position, such as a mass on a spring or pendulum.
EQN: x(t)=Acos(2πft)
33. The location of a particle moving in the x-y plane is given by the parametric equations x = t2
+ 4t and y = (1/4) t4 – 60t, where x and y are in meters and t in seconds. What is the
particle’s velocity at t = 4sec?
a. 8. 95 m/s b. 11.3 m/s c. 12.6 m/s * d. 16.0 m/s
Resultant = h
*Since it is about parametric equation and velocity is to be determined at time t = 4 sec, x’(t)
and y’(t).
x'(t) = 2t + 4 ; y’(t) = t3 – 60, then @ t = 4; x = 12, y = 4
Recall: Power = 2piTN ; Stress = P/A = 16T/piD3 for solid shaft or 16TD/pi(D4-d4) for hollow shaft
Solving for T; 59 N/mm2 = 16T/pi(55mm)3 ; T = 1927391.637 N-mm = 1927.39163 N-m
Finally, Solving for Power = 2piT(N/60) = 2 * pi * 1927.39163 * 480/60 = 96881.27 W = 96.88kw
37. A 30-m long aluminum bar is subjected to a tensile stress of 172MPa. Find the elongation if
E=69,116MPa.
a. 0.746m b. 0.007m c. 6.270mm d. 7.46cm *
38. A copper rolled wire 10m long and 1.5mm diameter when supporting a weight of 350N
elongates 18.6mm. Compute the value of the Young’s modulus of this wire.
a. 200GPa b. 180.32GPa c. 148.9GPa d. 106.48GPa*
39. A simple beam 10m long carries a concentrated load of 200kN at the midspan. What is the
maximum moment of the beam?
a. 250kN-m * b. 500kN-m c. 400kN-m d. 100kN-m
40. A spherical pressure vessel 400-mm in diameter has a uniform thickness of 6 mm. The
vessel contains gas under a pressure of 8,000 kPa. If the ultimate stress of the material is
420 MPa, what is the factor of safety with respect to tensile failure?
a. 3.15 * b. 3.55 c. 2.15 d. 2.55
ME 601
41. During a stress-strain test, the unit deformation at a stress of 35 MPa was observed to be
t t
ଦ m/m and at a stress of 140 MPa it was ଦ m/m. If the proportional
limit was 200 MPa, what is the modulus of elasticity? What is the strain corresponding to
stress of 80 MPa?
t
a. E = 210,000 MPa; m/m
t
b. E = 200,000 MPa; m/m
t
c. E = 211,000 MPa; m/m
t
d. E = 210,000 MPa; m/m *
Given:
Deformation @P = 35 MPa is δ = 167*10-6
Deformation @P = 140 MPa is δ = 667*10-6
Emod = [35 x 106 N/m2]/[167 x 10-6 m/m] = 2.09 x 1011 which is also with the same proportion
Emod = [140 x 106 N/m2]/[667 x 10-6 m/m] = 2.09 x 1011
Therefor, E is approximately 210 MPa
42. An axial load of 100 kN is applied to a flat bar 20 mm thick, tapering in width from 120 mm
to 40 mm in a length of 10 m. Assuming E = 200 GPa, determine the total elongation of the
bar.
a. 3.43 mm * b. 2.125 mm c. 4.33 mm d. 1.985 mm
Consider Fig:
ME 601
Consider a differential lenght for which the cross-sectional area is constant. Then the total
elongation is the sum of these infinitesimal elongations.
At sector m-n, the half width y (mm) at the distance x (m) from the left end is found from
geometry to be:
(y-20)/x = (60-20)/10
y = (4x + 20)mm
43. A 20-mm diameter steel rod, 250 mm long is subjected to a tensile force of 75 kN. If the
Poisson’s ratio is 0.30, determine the lateral strain of the rod. Use E = 200 GPa.
t
a. y li mm/mm
t
b. y t li mm/mm *
t
c. y t l ଦ mm/mm
t
d. y l ଦ mm/mm
44. The maximum allowable torque, in kN-m, for a 50-mm diameter steel shaft when the
allowable shearing stress is 81.5 MPa is:
a. 3.0 b. 1.0 c. 4.0 d. 2.0 *
Recall: Torque
Stress = P/A = 16T/piD3 for solid shaft or 16TD/pi(D4-d4) for hollow shaft
81.5 MPa = 16T/pi(50mm)3
T=2
ME 601
45. Compute the value of the shear modulus G of steel whose modulus of elasticity E is 200 GPa
and Poisson’s ratio is 0.30.
a. 72,456 MPa c. 76,923 MPa *
b. 79,698 MPa d. 82,400 MPa
Engineering Economy:
46. A member of congress wants to know the capitalized cost of maintaining a proposed
national park. The annual maintenance cost is expected to be ₱20,000. At an interest rate of
6% per year, the capitalized cost of the maintenance would be closest to:
a. ₱1,500 b. ₱25,000 c. ₱333,333* d. ₱416,667
47. A machine has a first cost of ₱100,000 and salvage value of ₱10,000 after 10 years. The
annual maintenance of the machine is ₱4,000. If interest rate is 10%. Find the annual cost of
the machine.
a. ₱17,009.34 b. ₱19,647.08* c. ₱21,083.56 d. ₱32,074.56
48. A certain product has the following corresponding cost: 250 units for ₱4,000 and 400 units
for ₱5,000. Find the increment cost.
a. 3.46 b. 4.05* c.5.31 d. 6.67
ME 601
Recall: Incremental cost is the additional cost (or revenue) that results from increasing the
output of the system by one or more units.
Increment costs are those that arise as a result of a change in operations or policy.
49. A machine has an initial cost of ₱50,000 and a salvage value of ₱10,000 after 10 years. What
is the book value after seven years using straight-line depreciation?
a. ₱22,000* b. ₱23,000 c. ₱24,000 d. ₱25,000
Depreciation, dstraight line method = (Initial Cost – Cost at nth year)/(nth year)
50. A machine that costs ₱20,000 has a 10 year life and a ₱2,000 salvage value. If straight line
depreciation is used, what is the book value of the machine at the end of the fourth year?
a. ₱12,200 b. ₱12,400 c. ₱12,600 d. ₱12,800*
51. A manufacturing firm maintains one product assembly line to produce signal generators.
Weekly demand for the generator is 35 units. The line operates for 7 hours per day, 5 days
per week. What is the maximum production time per unit in hours required of the line to
meet the demand?
a. 1 hour * b. 3 hours c. 2 hours
d. 4 hours
7 hours/unit * 5 days = 35
35 units/35 = 1 hour
52. What is the capitalized cost of a project that will cost P20,000,000 now and will require
P3,000,000 in maintenance annually? The effective annual interest rate is 15%.
a. P30,000,000 c. P40,000,000 *
b. P50,000,000 d. P60,000,000
53. How much money must be invested today in order to withdraw P12,000 per year for 12
years if the interest rate is 12%?
a. P44,332.49
b. P54,332.49
c. P74,332.49 *
d. P94,332.49
A = 12000 ; n = 12 ; i = 0.12
P = 12000 |(1 + 0.12)12 - 1|/ (0.12)(1 + 0.12)12 = 74332.49
ME 601
54. In a small factory with a capacity of 500,000 units per year with a 75% efficiency, the annual
income is P500,000 and a fixed cost of P180,000 and variable cost of P0.52 per unit. What is
the break-even point?
a. 222,223 units *
b. 242,223 units
c. 252,223 units
d. 222,222 units
FC = 180000
55. An equipment costing P250,000 has an estimated life of 15 years with a book value of
P30,000 at the end of the period. Compute the depreciation charge and its book value after
10 years using the sum of year’s digit method.
a. d = P11,000; BV = P67,500
b. d = P10,500; BV = P58,000
c. d = P11,500; BV = P60,000
d. d = P11,000; BV = P57,500 *
Thermodynamics 1:
56. A perfect gas has a value of R= 58.8 ft-lb/lb-R and K= 1.26. if 20 Btu are added to 10 lbs of
his gas at constant volume when initial temperature is 90 degF find the final temperature.
Q = mCv(dT)
Cv = R/k-1 = 58.8/1.26 - 1 * (1/778) = 0.29086 Btu/lb-F
ME 601
57. A spherical balloon with a diameter of 6 m is filled with helium at 20 deg. C and 200 Kpa.
Determine the mole number.
a. 9.28 Kmol * b. 10.28 Kmol c. 11.28 Kmol d. 13.28 Kmol
Recall: PV = nRT
200 [4/3 pi * (6/2)^3] = N * (8.3143)*(20+273)
N = 9.28 kmol
58. A one cubic meter container contains a mixture of gases composed of 0.02 kg/mol of
oxygen and 0.04 kg-mol helium at a pressure of 220 Kpa. What is the temperature of this
ideal gas mixture in degrees kelvin?
a. 441 * b. 350 c. 400 d. 450
Thermodynamics 2:
61. Steam leaves an industrial boiler at 827.4 kPa and 171.6C. A portion of the steam is passed
through a throttling calorimeter and is exhausted to the atmosphere when the calorimeter
pressure is 101.4 kPa. How much moisture does the steam leaving the boiler contain if the
temperature of the steam at the calorimeter is 115.6C?
At 827.4 kPa (171.6C): hf = 727.25 kJ/kg, hfg = 2043.2 kJ/kg
From table 3: at 101.4 kPA and 115.6C: h2 = 20707.6 kJ/kg
a. 6.78% b. 3.08%* c. 4.56% d. 2.34%
62. One kg of steam at 121C and 10% moisture undergoes a constant volume until the pressure
becomes 0.28 Mpa. Determine the final temperature.
a. 200.4C b. 374.5C c. 206.5C* d. 873.4C
Recall: V = C (Isochoric)
PV = mRT
63. A cylinder and piston arrangement contains saturated water vapor at 110C. The vapor is
compressed in a reversible adiabatic process until the pressure is 1.6 Mpa. Determine the
work done by the steam per kg of water.
a. -637 kJ b. -509 kJ c. -432 kJ* d. -330 kJ
64. A turbine has an available enthalpy of 3300 kJ/kg in a Rankine cycle. The pump work has
also 25 kJ/kg. For flow of 3 kg/s, find the system output.
a. 5960 kW b. 6080 kW c. 6343 kW d. 9825 kW*
65. A rankine cycle has a steam throttle condition of 4 Mpa and 400C. the turbine exhaust is 1
atm, fin the cycle efficiency.
a. 23.23% b. 27.06%* c. 34.23% d. 43.23%
Heat Transfer:
Recall: Convective Heat xfer (hAdT) and Radiant Heat xfer (seat^4)
A = 4piRad^2 = 4pi(0.05)^2 = 0.0314 m^2
Qo = hA(dT) = 15(0.0314)(70-20) = 23.56 watts
Qr = 0.80 (5.67 x 10^-8)(0.0314)[(70+273)^4-(50+273)^4] = 9.22 watts
Qt = Qo + Qr = 23.56 + 9.22 = 32.77 watts
ME 601
67. Hot gases at 280 degC flow on one side of a metal plate of 10mm thickness and air at 35
degC flows the other side. The heat transfer coefficient of the gases is 31.5 W/m^2-k and
that of the air is 32 W/m^2-K. calculate the over all transfer coefficient.
a. 15.82 W/m^2-K* c. 16.82 W/m^2-K
b. 14.82 W/m^2-K d. 17.82 W/m^2-K
68. How many watts will be radiated from a spherical black body 15 cm in diameter at a
temperature of 800 degC?
a.5.34 KW* b. 4.34 KW c. 6.34 KW d. 3.34 KW
69. During a steady state operation, a gearbox receives 60kW through the input shaft and
delivers power through the output shaft. For the gear box as the system, the rate of energy
transfer is by convection. h=0.171 kW/m2K is the heat transfer coefficient, A=1m2 is the
outer surface area of the gear box, Th=300K (27C) is the temperature and the outer surface,
Tf=293K (20C) is the temperature of the surroundings away from the immediate vicinity if
the gear box. Determine the power delivered to the output shaft in kW if the heat transfer
rate is 1.2 kW.
a. 98.8 KW b. 78.8 KW c. 68.8 KW d. 58.8 KW*
dE/dt = Q - W;
W=Q
W = W1 + W2 = Q
W1 = -60kW
Q = -1.2
W2 = power delivered to the output shaft, kW = -1.2kW - (-60kW) = 58.8 kW
ME 601
70. Determine the thermal conductivity of a material that is used a 4 m2 test panel, 25 mm
thick with a temperature difference of 20F between surfaces. During the 4 hrs of test period,
the heat transmitted is 500 kJ.
a. 0.0432 W/m-Cb. 0.0723 W/m-C c. 0.0321 W/m-C d. 0.0195 W/m-C*
Fluid Mechanics:
71. What is most nearly the terminal velocity of a 50 rnrn diameter, solid aluminum sphere
falling in air? The sphere has a coefficient of drag of 0.5, the density of aluminum, Palum, is
2650 kgjm3, and the density of air, Pair, is 1.225 kgjm3
a. 25 m/s b. 53 m/s * c. 88 m/s d. 130 m/s
72. What is the static head corresponding to a flow velocity of 10 ft/sec?
a. 1.55 ft* b. 1.75 ft c. 2.05 ft d. 2.25 ft
73. Water flows rate along ½ in. i.d. nose at 3 gal/min. Water velocity in ft/sec is nearest to:
a. 1 b. 5* c. 10 d. 20
74. Find the depth in furlong of the ocean (SG = 1.03) if the pressure at the sea bed is 2,032.56
kpag.
a. 1 * b. 2 c. 3 d. 4
P = yheight
2032.56 = 1.03 * 9.81 * height
h = 201.158 m (3.281 ft/m)(1 yd/3ft)(furlong/220 yd) = 1 furlong
75. The work required to accelerate an 800-kg car from rest to 100 km/hr on a level road:
a. 308.6 kJ* b. 806.3 kJ c. 608.3 kJ d. 386 kJ
Combustion:
76. The dry exhaust gas from oil engine has the following gravimetric analysis: CO2 = 21.6%; O2
= 4.2%; N2 = 74.2%
Specific heats at constant pressure for each component of the exhaust gas in Kcal/kgoC
are: CO2 = 0.203; O2 = 0.219; N2 = 0.248. Calculate the specific gravity if the molecular
weight of air is 28.97 kg/kg-mol.
a. 0.981 b. 1.244 c. 1.055 * d. 0.542
ME 601
77. An unknown hydrocarbon fuel, CxHy, is burned with excess air containing 23.3% oxygen by
mass. The volumetric analysis of the dry products of combustion is as follows: 11.94% CO2,
0.41% CO, 2.26% O2, AND 85.39% N2. Find the value of x and y, respectively.
a. 14.35, 44.22 b. 12.35, 33.22* c. 10.35, 32.33 d. 14.35,
32.33
78. A typical industrial fuel oil, C16H32 with 20% excess air by weight. Assuming complete
oxidation of the fuel, calculate the actual air-fuel ratio by weight.
a. 17.56 kgair/kgfuel c. 15.76 kgair/kgfuel
b. 16.75 kgair/kgfuel d. 17.65 kgair/kgfuel*
Theoretical Eqn:
FUEL + AIR = PRODUCTS
Material Balance:
C: 16 = b(1) b = 16
H: 32 = 2c c = 16
O: 2a = 2b + c a = 24
N: 3.76a = 90.24
Next, Compute Actual Reaction Equation (consider the 20% excess air):
C16H32 + 1.2(24O2 + 90.24N2) = 16CO2 + 16H2O + 1.2(90.24N2)
ME 601
Computing variable d:
O: 1.2(24)(1) = 16(2) + 16 + 2d
d = 4.8 kgmol
Finally,
C16H32 + 1.2(24O2 + 90.24N2) = 16CO2 + 16H2O + 1.2(90.24N2) +
(4.8)O2
79. Fuel oil in a day tank for use of an industrial boiler is tested with hydrometer. The
hydrometer reading indicates a S.G. = 0.924 when the temperature of the oil in the tank is
350C. Calculate the higher heating value of the fuel.
a. 43,852.13 kJ/kg* c. 53,853.13 kJ/kg
b. 58,352.13 kJ/kg d. 48,352.13 kJ/kg
Recall: HHV/dulong
Qh = 41130 + 139.6(API)
API = 141.5/SG15.6 – 131.5
SG correction factor:
SG35 = SG15.6(1-0.00072(35-15.6))
0.924 = SG15.6(1-0.00072(35-15.6))
SG15.6 = 0.937
80. A diesel electric plant supplies energy for Meralco. During a 24 hr period, the plant
consumed at 700 gallons of fuel at 280C and produce 3930 kW-hr. industrial fuel used is
280API and was purchased at P 5.50 per liter at 15.60C. What should the cost of fuel be
produce one kW-hr?
a. 1.05* b. 1.10 c. 1.069 d. 1.00
Solving for density at 15.6 celcius:
API = 141.5/SG15.6 + 131.5
28 = 141.5/SG15.6 + 131.5
ME 601
SG15.6 = 0.887
ME Laws:
81. If the rated scores of an examinee in a board exam are 85, 82, and 48 in Math, Power, and
Design subjects respectively (average: 72.85%), what will be the overall result?
a. Pass b. Fail * c. Removal exam d. Deferred
82. Which of the following is NOT a qualification for being a member of the Board
of Mechanical Engineering (BME)?
a. Must be at least thirty-five (35) years of age
b. Naturalized or born Filipino citizen *
c. Has never been convicted of any offense involving moral turpitude
d. A Professional Mechanical Engineer with a valid professional license and an active
practitioner as such, for not less than ten (10) years prior to his appointment
83. A foreign mechanical engineer may only be allowed to practice mechanical engineering in
the Philippines if his country also allows Filipino mechanical engineers practice under similar
provisions like those in RA8495. This policy is also known as
a. Foreign Reciprocity *
b. Foreign Reciprocality
c. Foreign engineer exchange
d. Foreign affairs
ME 601
84. According to RA 8495, where will the budget to implement Mechanical Engineering Law
come from?
a. Local Budget
b. Foreign funding
c. National Budget *
d. From members of PSME
85. A plant with rated capacity 500 kW requires with 3 shifts has:
a. At least one(1) registered mechanical engineer or Professional Mechanical engineer
for all three shifts
b. At least two(2) registered mechanical engineer or Professional Mechanical engineer
for all three shifts
c. At least three(3) registered mechanical engineer or
Professional Mechanical engineer, one per shift *
d. At least four (4) registered mechanical engineer or Professional Mechanical engineer,
one per shift plus one (1) as a buffer
Basic Electronics
86. If N1/N2 = 2, and the primary voltage is 120 V, what is the secondary voltage?
a. 0 V b. 36 V c. 60 V * d. 240 V
Consider ratio:
N1/N2 = Primary/Secondary
2 = 120V/Secondary
Secondary = 120V/2 = 60 V
87. A transformer has a turns ratio of 4: 1. What is the peak secondary voltage if 115 V rms is
applied to the primary winding?
a. 40.7 V * b. 64.6 V c. 163 V d. 650 V
N1/N2 = 4:1
RMS = Peak/sqrt(2) = 115
So, for the primary voltage peak
115 = Peakprimary/sqrt(2)
Peak primary = 162.6345 V
88. Line voltage may be from 105 V rms to 125 rms in a half-wave rectifier. With a 5:1 step-
down transformer, the maximum peak load voltage of an ideal approximation is closest to
a. 21 V b. 25 V c. 29.6 V d. 35.4 V*
89. What is the peak load voltage out of a bridge rectifier for a secondary voltage of 15 V rms?
(Use second approximation.)
a. 9.2 V b. 15 V c. 19.8 V * d. 24.3 V
Approximate computation:
15V = Vpeaksecondary / sqrt(2)
Vpeak Secondary = 21.21
Using second approximation: Diode is silicon with 0.7 voltage drop that doubles, considering it’s
a full bridge (4 diodes)
ACDC:
a. 30 Hz c. 120 Hz *
b. 60 Hz d. 240 Hz
92. If N1/N2 = 2, and the primary voltage is 120 V, what is the secondary voltage?
a. 0 V c. 60 V *
b. 36 V d. 240 V
V1/V2 = N1/N2
120V/V2 = 2
V2 = 120/2 = 60V
ME 601
93. A transformer has a turns ratio of 4: 1. What is the peak secondary voltage if 115 V rms is
applied to the primary winding?
a. 40.7 V * c. 163 V
b. 64.6 V d. 650 V
V1/V2 = 4/1
Vrms = Vpeak/sqrt(2)
162.6345/V2 = 4/1
V2 or V secondary = 162.6345/4 = 40.6586 = 40.7V
94. Line voltage may be from 105 V rms to 125 rms in a half-wave rectifier. With a 5:1 step-
down transformer, the maximum peak load voltage of an ideal approximation is closest to
a. 21 V c. 29.6 V
b. 25 V d. 35.4 V *
95. If the base current is 100 mA and the current gain is 30, the collector current is
a. 300 mA c. 3.33 A
b. 3 A * d. 10 A
96. From a lot of 10 grenades, 4 are selected at random and are thrown. If the lot contains 3
defective grenades that will not explode upon throwing, what is the probability that all 4
will explode?
ME 601
97. The probability that a person, living in a certain town, owns a cat is estimated to be 0.3. Find
the probability that the ninth person randomly interviewed in that town is the fourth one to
own a cat.
A. 0.089 B. 0.019 C. 0.076* D. 0.034
Analysis:
ME 601
RECALL: P=nCrPrQn-r
If the 9th person is the 4th to own a cat, there must be 3 cat owners among the first 8 people.
This can be found using binomial expansion theorem:
(8 C 3)(0.3)^3(0.7)^5= 0.25412 is the probability that there are 3 dog owners among the first 8
people. The 9th person must also own a dog, so multiply .3 to this number to get 0.076
(answer).
98. Find the probability that a person flipping a coin gets the third head on the seventh flip.
A. 15/128 * B. 11/128 C. 17/128 D. 19/128
Analysis:
RECALL: P=nCrPrQn-r
P occurs, Q (failed to occur)
The 3rd head must be on the 7th trial, the other 2 head in the remaining 6 trials;
99. Suppose the probability is 0.7 that any given person will believe a tale about the ECE board
exam leakage. What is the probability that the fifth person to hear this tale is the third one
to believe it?
A. 0.185 * B. 0.139 C. 0.110 D. 0.142
Analysis:
RECALL: P=nCrPrQn-r
P occurs, Q (failed to occur)
P(occur) = 0.7
Q(failed to occur) = 1 – 0.7 = 0.3
100. A veterinarian vaccinates several hamsters, one at a time, with a disease germ until he
finds 3 that have contracted the disease. If the probability of contracting the disease is 1/5,
what is the probability that 6 hamsters are required?
A. 0.091 B. 0.071 C. 0.041 * D. 0.021
Analysis:
RECALL: P=nCrPr+1Qn-r
P occurs, Q (failed to occur)
P(occur) = 1/5
Q(failed to occur) = 4/5
r+1=3
r=2
n = 6 hamsters – 1 = 5
Algebra:
nCr-1(first)n-r+1(second)r-1
10C7 = 120a7
2. The terms of a sum may be grouped in any manner without affecting the result. this is law
known as:
3. A group consists of n engineers and n nurses. If two of the engineers are replaced by two other
nurses, then 51% of the group members will be nurses. Find the value of n.
a. 80 b. 110 c. 55 d. 100*
n + 2 = no. of nurses
N = 100
4. Jose’s rate of doing work three times as fast as Bong. On given day Jose and Bong work together
for 4 hours then Bong was called away and Jose finishes the rest of the job in 2 hours. How long
would it take Bong to do the complete job alone?
5. A golf ball is dropped from a height of 6 meters. On each rebound it rises 2/3 of the height from
which it last fell. What distance has it traveled at the instant it strikes the ground for the 7th time?
a. 27.89 m* c. 20.87 m
b. 19.86 m d. 24.27 m
S = a1/(1-r)
a1 = 6*(2/3) = 4
Trigonometry:
6. In the right triangle ABC below, what is the cosine of angle A if the opposite side is 3 and the
adjacent side is 4.
CosA = Adjacent/Hyp
Opposite = 3
Adjacent = 4
7. The length of sides AB and AC in the triangle below are equal. What is the measure of angle ∠ A
if angle ∠ C is 70°?
Recall: Triangle with two equal sides. Angle A can be bisected to form a right triangle. Then, 90° + 70° +
BisectedA° = 20°, Finally, A° = 2*20° = 40°
8. What is the angle measured in degrees clockwise from the north to the direction in which the
carrier is traveling.
a. . bearing c. direction
b. azimuth d. course *
Recall:
Bearing means the direction a vessel is pointed, which is the measure of an acute angle with respect to
the north-south vertical line.
ME 601
Azimuth is defined as a horizontal angle measured clockwise from any fixed reference plane or easily
established base direction line.
Direction is expressed as the angular difference in degrees from a reference direction, usually true
North
Course (Heading) is the direction the vessel is actually travelling. It is the angle measured clockwise from
the north direction to the line of travel
==Course (heading) and bearing are only synonyms when there is no wind on land
Ans is COURSE.
Recall:
10. What is the value of the adjacent side if the opposite side is 1 inch and the 2 other angles of the
right triangle is 30° and 60°
a. 1/√3* b. √2 c. √3 d. 6/√3
Recall: Right Triangle Theorem for 30-60-90. Figure (1 inch goes to the shortest leg, √3 is the mid leg,
and 2 will be the hypotenuse)
ME 601
11. The base of a cylinder is a hexagon inscribed in a circle. If the difference in the circumference of
the circle and the perimeter of the hexagon is 4 cm., find the volume of the prism if it has an
altitude of 20 cm.
12. Locate the centroid of the area bounded by the parabola y2=4x, the line y=4 and the y-axis
a.6/5, 4 c. 6/5, 3 *
b.5/6, 3 d. 6/6, 3
y2 = 4x @ y = 4, then x = 4
y2 = 4x @ x = 4, then y = ±4
ME 601
We can assume, the parabola and the line y=4 intersect at points (4,4) and (4,-4)
32/3 y = 32
Y=3
32/3x = 25.59
13. Find the volume of a spherical cone in a sphere of radius 17 cm if the radius of its zone is 8 cm.
Vspcone = 1/3(Azone*Radiussphere)*Radiuszone
Azone = 2piRsphere = 2pi(17 cm) = 106.814 cm
Vsphericalcone = 1/3(106.814cm)(17cm)(8cm) = 4839.78 cm3
But: 1/3(106.814cm)(17cm) * 2 = 1210.56
14. Find the equation of the perpendicular bisector of the segment joining the points (2, 6) and (-4,
3).
a. 2x - 4y + 5 = 0 c. 2x + 4y + 5 = 0
b. 4x + 2y – 5 = 0* d. 5x – 2y + 4 = 0
15. What is the new equation of the line 5x + 4y + 3 = 0 if the origin is translated to the point (1, 2)?
5(1) + 4(2) + 3 = 16
Then
5x’ + 4y’ + 16 = 0
Differential Calculus
16. A snowball is being made so that its volume is increasing at the rate of 8 ft3/min. Find the rate at
which the radius is increasing when the snowball is 4 ft in diameter.
a. 0 b. infinity* c. indeterminate d. 3
Cannot be factored
Infinity (denominator is zero)
18. Given the total cost of producing x items is given by the function C(x) = 0.001x3 + 0.025x2 + 3x +
5. Compute the marginal cost of producing the 51st item.
a. $13.00* c. $ 12.00
b. $ 14.00 d. $ 11.00
Since C(x) is the approximate cost incurred to produce the (x + 1)st item we need to compute C(50). For
comparison, the exact cost to produce the 51st item is C(51) − C(50) = [0.001(51)3 + 0.025(51)2 + 3(51) +
5] −[0.001(50)3 + 0.025(50)2 + 3(50) + 5] = 355.676 − 342.50 = $13.176
ME 601
19. The dimensions of a rectangle are continuously changing. The length decreases at the rate of 2
in/sec while the width increases at the rate of 3 in/sec. At one instant the rectangle is a 20 inch
square. How fast is its area changing 3 seconds later?
a. 10 in2/sec c. 16 in2/sec*
b. 12 in2/sec d. 14 in2/sec
Consider: L = 20; W = 20
At time = 3 sec
L = 20 – 2in/sec(3sec) = 14 inches
W = 20 + 3in/sec(3sec) = 29 inches
Formula A = LW
a. 0 b. 31 c. 27* d. Infinity
Indeterminate if x = 0
Integral Calculus
dx
x 1 .
21. Find
a. x x 1 C c. 2x x 1 C
ME 601
b. 2 x 1 C * d. x 2x 1 C
Disregard integral sign, then solve using CALC mode with initial value as 1.1 for x
Note answer
Try each choices using function d/dx on calc with value of x = 1.1, answer should be the same with given
eqn
ANS: B 2 x 1 C
3x
2 y
22. Evaluate:
2
9y2 dxdy
0 0
a. 30 b. 50 c. 40 * d. 20
= h = h = h
= h = h = = 44 =answer approx. 40
23. Find the area of the region above the x axis bounded by the curve y = -x2 + 4x – 3.
24. Find the area in the first quadrant bounded by the parabola y2=4x and the line x=3 and x=1
ME 601
25. Find the volume of a solid formed by rotating the area bounded by y = x2, y = 8 – x2 and the y
axis about the x axis.
Differential Equations
26. If f(x) and g(x) are differentiable functions such that f '(x) = 3x and g'(x) = 2x2 then the limit lim
[(f(x) + g(x)) - (f(1) + g(1))] / (x - 1) as x approaches 1 is equal to
a. 5* b. 10 c. 20 d. 15
3(x) + 2(x) @x = 1; 3(1) + 2(1) = 5
2 2
31. How permutation can be made out of the letters in the world island taking four letters at a time?
a. 360* b. 720 c. 120 d. 24
32. The captain of a baseball team assigns himself to the 4th place in the batting order. In how many
ways can he assign the remaining places to his eight teammates if just three men are eligible for
the first position?
a. 2160 b. 40320 c. 5040 d. 15120*
7 on second post
6 on 3rd post
5 on 4rd post
….
3*(7!) = 15120
33. A bag contains 3 white and 5 black balls. If two balls are drawn in succession without
replacement, what is the probability that both balls are black?
a. 5/28 b. 5/16 c. 5/32 d. 5/14*
Total Balls = 8
(3W)(5B)
34. Find the mean, median and mode respectively of the following numbers: 13, 13, 14, 12, 11, 10, 9,
11, 8, 11, 5, and 15.
Recall:
Mean is average = 13 + 13 + 14 + 12 + 11 + 10 + 9 + 11 + 8 + 5 + 15 / 12 items = 11
Median = sort and then find middle value
= 15 14 13 13 12 11 11 11 10 9 8 5, even so average . 22/2 = 11
Mode: the number with highest frequency or appear the most = 11
Ans: 11, 11, 11
35. There are 4 white balls and 6 red balls in a sack. If the balls are taken out successively (the first
ball is not replaced), what is the probability that the balls drawn are of different colors.
Physics
36. What horizontal force P can be applied to a 100-kg block in a level surface with coefficient of
friction of 0.2, that will cause and acceleration of 2.50 m/s2?
a. 343.5 N c. 106 N
b. 224.5 N d. 446.2 N*
37. What is the force in newtons, required to move a car with 1000 kg mass with an acceleration of
12 m/s2?
38. A block weighing 500 kN rest on ramp inclined at 25 degrees with the horizontal. The force
tending to move the block down the ramp is:
39. What is the range of a projectile if the initial velocity is 30 m/s at an angle of 30 degrees with the
horizontal.
Analysis: Once fired with initial velocity, it will reach a maximum height reaching max velocity 0, then
from that instant, initial velocity would be 0 and acceleration due to gravity pulls the body gaining
velocity.
Range = Vo2(Sin(2*angle))/Acceleration due to gravity
= [(30 m/s)2*sin(2*30°)]/(9.81 m/sec2) = 79.4518 meters
40. A body weighs 40 lbs. starts from rest and inclined on a plane at an angle of 30o from the
horizontal for which the coefficient of friction l l How long will it move during the third
second?
a. 19.99 ft c. 18.33 ft
b. 39.63 ft d. 34.81 ft*
Summation of Forces at y = 0
W*sin∅ = REF + F
ME 601
W*sin∅ W/g * accel h th ∅ coeff of friction reacting to body moving down the wedge
Cancel out W
Sin∅ = accel/g + h ∅
A = 7.732 ft/sec2
Solving for distance, S = v*t + ½ a*t2 = 0*(3 sec) + ½ (7.732ft/sec2)(3 sec)2 = 34.794 ft
Mechanics
41. Determine the outside diameter of a hollow steel tube that will carry a tensile load of 500 kN at
a stress of 140 MPa. Assume the wall thickness to be one-tenth of the outside diameter.
a. 123 mm c. 103 mm
b. 113 mm* d. 93 mm
42. A force of 10 N is applied to one end of a 10 inches diameter circular rod. Calculate the stress.
a. 0.20 kPa* c. 0.10 kPa
ME 601
43. What force is required to punch a 20-mm diameter hole through a 10-mm thick plate? The
ultimate strength of the plate material is 450 MPa.
a. 241 kN c. 386 kN
b. 283 kN* d. 252 kN
44. A steel pipe 1.5m in diameter is required to carry an internal pressure of 750 kPa. If the
allowable tensile stress of steel is 140 MPa, determine the required thickness of the pipe in mm.
a. 4.56 c. 4.25
b. 5.12 d. 4.01*
Recall: Pressure Vessel (internal pressure causing tangential stress against thickness)
*From here: use backdoor or Caltech, noting answer should be close to 140 MPa
45. A spherical pressure vessel 400-mm in diameter has a uniform thickness of 6 mm. The vessel
contains gas under a pressure of 8,000 kPa. If the ultimate stress of the material is 420 MPa,
what is the factor of safety with respect to tensile failure?
a. 3.15* c. 2.15
ME 601
b. 3.55 d. 2.55
**Considering SF
Thickness = prn/2oy
Oy, Yield Stress = 420 MPa (Yield stress is the ultimate stress)
Thickness = 6 mm
46. A bomber flying at a horizontal speed of 800 kph drops a bomb. If the bomb hits the
ground in 20 seconds, calculate the vertical velocity of the bomb as it hit the ground.
a. 169 m/sec
b. 196 m/sec *
c. 175 m/sec
d. 260 m/sec
47. A flywheel starting from rest develops a speed of 400 rpm in 30 seconds. How many
revolutions did the flywheel make in 30 seconds it took to attain 400 rpm.
a. 100 rev *
b. 150 rev
c. 120 rev
ME 601
d. 360 rev
48. A 100 kg block of ice is released at the top of a 300 incline 10 meters above the ground.
If the slight melting of the ice renders the surface frictionless, calculate the velocity at
the foot of the incline.
a. 30 m/sec
b. 24 m/sec
c. 14 m/sec *
d. 10 m/sec
49. What drawbar pull is required to change the speed of a 120,000 lb car from 15 mph to
30 mph on a half mile while the car is going up a 1.5% upgrade? Car resistance is 10
lb/ton.
a. 3425 lbs *
b. 3542 lbs
c. 3245 lbs
d. 4325 lbs
Vo = 15 mi/hr
Vf = 30 mi/hr
**half mile (distance travelled)
Mass = 120,000 lb
tan∅ = 0.015
∅ = 0.8593
ME 601
50. A body weighing 200 kg is being dragged along a rough horizontal plane by a force of 45
kg. If the coefficient of friction is assumed to be 1/12 and the line pull makes an angle of
180 with the horizontal, what is the velocity acquired from rest in the first 3 meters.
a. 2.8 m/sec *
b. 3.1 m/sec
c. 3.5 m/sec
d. 4.9 m/sec
Thermodynamics 1
51. An iron block weighs 5 Newton and has volume of 200 cm^3. What is the density of the block?
a. 2458 kg/m^3
b. 2485 kg/m^3
c. 2584 kg/m^3
d. 2549 kg/m^3*
5 N kg = F = m*accel
52. If air is at a pressure of 22.22 Psia and at temperature of 800 degR, what is the specific volume?
a. 11.3 ft^3/lbm
b. 33.1 ft^3/lbm
c. 13.3 ft^3/lbm*
d. 31.3 ft^3/lbm
53. The specific gravity of mercury is 13.55. what is the specific weight of mercury?
a. 123.9 Kn/m^3
b. 139.2 Kn/m^3
c. 132.9 Kn/m^3*
d. 193.2 Kn/m^3
54. The equivalent weight of mass 10 kg at location where the acceleration of gravity is 9.77
m/sec^2
a. 97.7 N*
b. 79.9 N
c. 77.9 N
d. 977 N
55. Transportation company specializes in the shipment of pressurized gaseous material. An order is
received for 100 liters of a particular gas at STP (32 degF and 1 atm). What minimum volume
tank is necessary to transport the gas at 80 degF and maximum pressure of 8 atm?
ME 601
a. 16 liters
b. 14 liters*
c. 10 liters
d. 12 liters
Recall: Required to compute for the volume. The problem didn’t state any condition (e.g. rigid, constant
temp, adiabatic etc.)
[PV/T]1 = [PV/T]2
Thermodynamics 2
56. An air standard engine has a compression ratio 18 and a cut-off ratio 4. If the intrake air
pressure and temperature are 100 kpa and 27deg C, find the work in KJ per kg.
a. 2976
b. 2166
c. 1582*
d. 2751
Recall Engines: 2 types (otto and diesel) (problem did not state which of the two types, use analysis base
on formula ratios since it is generic to all ICE’s )
Cut-off Ratio = V3/V2 = 4 only Otto cycle doesn’t have Cut off **assume this is diesel
P1 = 100 kPa
T1 = 27 °C
57. Determine the air – standard efficiency of an engine operating on the diesel cycle when the
suction pressure is 99.97KPa and the fuel injected for 6% of the stroke, the clearance volume is
8% of the stroke. Assume k = 1.4.
a. 60.70 %*
b. 65.01%
c. 67.01%
d. 64.02%
V3 - V2 = 0.08VD
V2 = 0.06VD
V3 = 0.08VD + 0.06VD
V3 = 0.14VD
rk = (1 + 0.06)/(0.060) = 17.667
58. A 23.5 kg of steam per second at 5MPa and 400oC is produced by a steam generator. The
feedwater enters the economizer at 145oC and leaves at 205oC. The steam leaves the boiler
drum with a quality of 98%. The unit consumes 3kg of coal per second as received having a
heating value of 25102 KJ/kg. What would be the overall efficiency of the unit in percent?
Steam properties:
At 5MPa and 400oC: h=3195.7KJ/kg
ME 601
59. In a Rankine cycle steam enters the turbine at 2.5MPa (enthalpies and entropies given) and
condenser of 50KPa (properties given), what is the thermal efficiency of the cycle?
At 2.5MPa: hg = 2803.1 sg = 6.2575
At 50KPa: sf = 1.0910 sfg = 6.5029
hf = 340.49 hfg = 2305.4 vf = 0.0010300
a. 25.55%*
b. 28.87%
c. 30.12%
d. 31.79%
h1 = hg = 2803.1
s2= s1 = sg = 6.2575
solving h2 = hf + xhfg
h3 = hf = 340.49
ƞTHERMAL = 25.54%
60. A 4 liter (2-liters per revolution at standard pressure and temperature) spark ignition engine has
a compression ratio of 8 and 2200 KJ/kg heat addition by the fluid combustion. Considering a
cold air standard Otto cycle model, how much power will the engine produce when operating at
2500 rpm?
a. 166.53 hp *
b. 73.12 hp
c. 97.4 hp
d. 148 hp
Mass flow rate = 2 Liter/rev(m3/1000 Liter)(2500 rev/min)(1 min/sec)(2 kg/m3)= 0.10 kg/sec
= 166.6078 HP
Heat Transfer
61. The surface of household radiator has an emissivity of 0.55 and an area of 1.5 m2. At what rate
is the radiation absorbed emitted by the radiator when its temperature is 50 deg. C.?
a. 308 W b. 509 W* c. 108 W d. 409 W
62. Cool water at 9 deg. C enters hot-water from which warm water at a temperature of 80 deg. C is
drawn at an average rate of 300 g/min. How much average electric power does the heater
consume in order to provide hot water at this rate?
a. 4.18 kW*
b. 2.35 kW
c. 3.31 kW
d. 5.14 kW
ME 601
63. Water (specific heat cv = 4.2 kJ/kg-K) is being heated by a 1500W heater. What is the rate of
change in temperature of 1 kg of the water?
a. 0.043 K/s
b. 0.719 K/s
c. 0.357 K/s*
d. 1.50 K/s
64. One kilogram of water (cv = 4.2 kJ/kg-K) is heated by 300 BTU of energy. What is the change in
temperature, in K?
316.5 kJ = m(4.2)(DeltaT)
Temp = 75.3571 K
65. The condenser of a reheat power plant rejects heat at the rate of 600 kW. The mass flow rate of
cooling water is 5 kg/s and the inlet cooling water temperature is 35C. Calculate the condenser
cooling water exit.
Q = mCp(DeltaT)
Fluid Mechanics
66. Determine the submerged depth of a cube of steel 0.3 m on each side floating in mercury. The
specific gravities of steel and mercury are 7.8 and 13.6 respectively.
a. 0.155 m b. 0.165 m c. 0.134 m d. 0.172 m*
SP gravity steel * gravity water * volume of steel = SP gravity mercury * gravh2o * 0.3*disp
7.81*9.81*0.33 = 13.6*9.81*0.32*d
d = 0.172 m
67. A block of wood floats in water with 5 cm projecting above the water surface. When placed in
glycerine of specific gravity of 1.35, the block projects 7.5 cm above the liquid. Determine its
specific gravity.
a. 0.514 b. 0.704 c. 0.836 d. 0.658*
Equating 1 and 2
Height = 14.6428
68. A solid cube material is 0.75 cm on each side. If it floats in oil of density 800 kg/m^3 with one-
third of the block out of the oil, what is the density of the material of the cube?
a. 533 kg/m^3 *
b. 523 kg/m^3
c. 513 kg/m^3
d. 543 kg/m^3
69. A hollow cylinder 1 m in diameter and 2 m high weighs 2825 N. How many kN of lead weighing
110 kN/m^3 must be fastened to the outside bottom of the cylinder to make it float with 1.5 m
submerged in water?
a. 8.5 KN * b. 6.5 kN c. 1.5 kN d. 9.5 kN
ME 601
Bouyant Force of Cylinder + Bouyant Force of Lead = Weight of Cyl + Weight of Lead
= 11.56 kN
70. A 1 m x 1.5 m cylindrical tank is full of oil with SG = 0.92. Find the force acting at the bottom of
the tank in dynes.
a. 106.33 x 103 dynes
b. 106.33 x 104 dynes
c. 106.33 x 105 dynes
d. 106.33 x 106 dynes*
P = F/A
Combustion
71. The dry exhaust gas from oil engine has the following gravimetric analysis: CO2 = 21.6%; O2 =
4.2%; N2 = 74.2%
Specific heats at constant pressure for each component of the exhaust gas in Kcal/kgoC are: CO2
= 0.203; O2 = 0.219; N2 = 0.248
Calculate the specific gravity if the molecular weight of air is 28.97 kg/kg-mol.
ME 601
O2 = (4.2%)/(2*16) = 0.0013125
N2 = (74.2%)/(2*14) = 0.0264
72. A bituminous coal has the following composition: C = 71.5%; H = 5.0%; O = 7.0%; N = 1.3%; S =
3%; Ash = 7.6%; W = 3.4%. Determine the theoretical weight of nitrogen in lb/lb of coal.
= 9.7746 lbAIR/lbCOAL
73. A gaseous fuel mixture has a molal analysis: H2 = 14%; CH4 = 3%; CO = 27%; O2 = 0.6%; CO2 =
4.5%; N2 = 50.9%; Determine the air fuel ratio for complete combustion of molal basis.
Actual O2 in product = oxygen from left side – O2 from given fuel (0.6%)
74. A volumetric analysis of a gas mixture is as follows: CO2: 12%; N2: 80%; O2: 4%; CO: 4%. What is
the percentage of CO2 on a mass basis?
Total = 30.08
75. The following coal has the following ultimate analysis by weight: C = 70.5%; H2 = 4.5%; O2 = 6.0%;
N2 = 1.0%; S = 3.0%; ash = 11%; moisture = 4%. A stocker fired boiler of 195000kg/hr steaming
ME 601
capacity uses this coal as fuel. Calculate volume of air in m3/kg with air at 60oF and 14.7 psia
pressure of boiler efficiency is 70% and FE = 1.10.
= 9.53025
PV = MRT
V = 234019 m3/hr
ME Laws
79. A member of the board shall hold office for alarm of ___ years from the date of his appointment.
a. three * b. two c. one d. four
80. No member of the Board shall serve for more than ____ regular terms.
a. One b. two * c. three d. none of the above
Engineering Economy
81. An employee obtained a loan of P10,000 at the rate of 6% compounded annually in order to
repair a house. How much must he pay monthly to amortize the loan within a period of ten
years?
a. P198.20 b. P150.55 c. P110.22 * d. P112.02
Recall: Amortization, requires equal payments for a given period. Therefore, annuity.
i = (1 + i/12)12 – 1
0.06 = (1+i/12)12 – 1
i=
82. What is the accumulated value of a payment of P12,500 at the end of each year for 9 years with
interest at 5% compounded annually?
a. P138,738.05 c. P137,832.05 *
b. P178,338.50 d. P187,833.50
Accumulated Value means total value or sum of all payments (use Future Worth Formula)
83. What is the accumulated value of a payment of P6,000 every six months for 16 years with
interest at 7% compounded semiannually?
a. P312,345.00 c. P345,678.00
ME 601
b. P347,898.00 d. P344,007.00 *
84. A mining property is offered for sale for P5.7M. On the basis of estimated production, an annual
return of P800,000 is foreseen for a period of 10 years. After 10 years, the property will be
worthless. What annual rate of return is in prospect?
a. 6.7% * b. 7.1% c. 8.6% d. 5.2%
Recall: Depreciation
85. If a down payment of P600,000 is made on a house and P80,000 a year for the next 12 years is
required, what was the price of the house if money is worth 6% compounded annually?
a. P1,270,707 * c. P1,130,450
b. P1,345,555 d. P1,678,420
Period = 12 Years
86. What is the effective rate for an interest rate of 12% compounded continuously?
a. 12.01% b. 12.89% c. 12.42% d. 12.75% *
I = 0.12
87. How long will it take for an investment to fivefold its amount if money is worth 14%
compounded semi-annually?
a. 11 b. 12 * c. 13 d. 14
5 = 1(1+0.14/2)2*PERIOD
88. An interest rate of 8% compounded semiannually is how many percent if compounded quarterly?
a. 7.81% b. 7.85% c. 7.92% * d. 8.01%
(1 + x/4)4*PERIOD = (1 + 0.08/2)2*PERIOD
X = 7.92%
89. A man is expecting to receive P450,000.00 at the end of 7 years. If money is worth 14%
compounded quarterly, how much is it worth at present?
a. P125,458.36
b. P147,456.36
c. P162,455.63
d. P171,744.44 *
Interest = 0.14
Period = 7 years
90. A man has a will of P650,000.00 from his father. If his father deposited an account of
P450,000.00 in a trust fund earning 8% compounded annually, after how many years will the
man receive his will?
a. 4.55 years b. 4.77 years * c. 5.11 years d. 5.33 years
Interest = 0.08
Period = unknown
AC/DC
91. What is the equivalent capacitance of two series capacitors rated 4 and 6 µF respectively?
a. 2.4 * c. 0.416
b. 10 d. 0.9
92. Three resistorsR1, R2 and R3 are connected in series across a 100-V source. If R_2 opens, the
R2 = 100V
94. When one metal bar is heated. The other part gradually becomes heated, that is, energy will
flow from hot part to cold part. What is the mode of heat transfer?
a. radiation c. conduction *
b. convection d. fusion
ME 601
95. What is the power required to transfer 97,000 coulumbs of charge through a potential rise of 50
volts in one hour?
a. 0.55 kW c. 0.9 kW
b. 1.3 kW * d. 2.8 kW
1 coulumb * 1 v = 1J
Basic Electronics
97. The flow of valence electrons to the left means that holes are flowing to the
a. Left b. Right* c. Either way d. None of the above
98. If you wanted to produce a p-type semiconductor, which of these would you use?
a. Acceptor atoms* c. Donor atoms
b. Pentavalent impurity d. Silicon
99. What is the drop across the diode when it is connected in series to a resistor of 1.8 kΩ and a
supply voltage of 50 V. The supply voltage causes the diode to be reverse-biased.
a. 50 V*
b. 0.7 V
c. 0.3 V
A reverse-biased diode, creates an open circuit (in series). An open circuit has an equivalent voltage
drop. Ans: 50V
100. __________is the procedure by which an atom is given a net charge by adding or taking
away electron.
a. Polarization
b. Irradiation
ME 601
c. Ionization *
d. Doping
Algebra:
1. If ax = by and bp = aq , then
a. px = qy *
b. xy = pq
c. xp = yq
d. qx = py
Let a =
bp = ( )q = (by)q/x = (b)y*q/x
logbp = logby*q/x
p = y*q/x
p/y = q/x
px = qy
4. It takes Michael 60 seconds to run around a 440-yard track. How long does it take Jordan to run
around the track if they meet in 32 second after they start together in a race around the track in
opposite direction?
a. 58.76 seconds
b. 68.57 seconds *
c. 65.87 seconds
d. 86.57 seconds
440 yards – 234 yardss = 205.333 yds this is what Jordan covered in 32 sec
5. The time required by an elevator to lift a weight, vary directly with the weight and the distance
through which it is to be lifted and inversely as the power of the motor. If it takes 30 seconds for
a 10-hp motor to lift 100lbs through 50 feet, what size of motor is requires to lift 800 lbs. in 40
seconds through a distance of 40 feet?
a. 48 hp *
b. 50 hp
c. 56 hp
d. 58 hp
ME 601
Computing for k
30 sec = k(100lbs*50ft)/10 hp
K = 0.06
Motor = 48 HP
Trigonometry
a. 180° x / π
b. π x / 180° *
c. 180° π / x
d. 180° π x
a. 80 mils
b. 800 mils *
c. 8000 mils
d. 80000mils
a. 90°
b. 57.3°
c. 180° *
d. 45°
2π rad = 1 rev
360° = 1 rev
9. The sum of the sides of a triangle is equal to 100 cm. If the angles of the triangle are in the
continued proportions of 1:2:4. Compute the shortest side of the triangle.
a. 17.545
b. 19.806 *
c. 18.525
d. 14.507
10. The sides of the triangular field which contains an area of 2400 sq. cm. are in continued
proportion of 3:5:7. Find the smallest side of the triangle.
a. 45.74
b. 63.62
c. 95.43
d. 57.67 *
ME 601
X = 19.222cm
Analytic Geometry
11. Determine the equation of the line tangent to the graph y = 2x2 + 1, at the point (1, 3).
a. y = 4x + 1
b. y = 4x – 1 *
c. y = 2x – 1
d. y = 2x + 1
Line tangent to a curve has the same points. Cross check points on the graph and the given.
12. Find the equation of the tangent to the curve x2 + y2 = 41 through (5, 4).
a. 5x + 4y = 41 *
b. 4x – 5y = 41
c. 4x + 5y = 41
d. 5x – 4y = 41
Line tangent to a curve has the same points. Cross check points on the graph and the given.
13. The midpoint of the line segment joining a moving point to (6, 0) is on the line y=x. Find the
equation of its locus.
a. x – y + 6 = 0*
b. x – 2y + 6 = 0
c. 2x – y -3 = 0
d. 2x + 3y – 5 = 0
Analysis: Static Point is at (6,0). Moving Point is y = x. Locus is line equidistant to a given condition. In
this case the midpoint.
Y = X. @ given point X = 6
14. The base of an isosceles triangle is the line from (4,-3) to (-4, 5). Find the locus of the third
vertex.
a. x – y + 1 = 0 *
b. x + y + 1 = 0
c. x – y – 2 = 0
d. x + y – 3 = 0
|y1 -3 5 |y1
4 = -8x + 20 -8y – 12 = 8x +8 – 8y
1 = -2x + 2 – 2y
15. What is the new equation of the line 5x + 4y + 3 = 0 if the origin is translated to the point (1, 2)?
c. 4x’ + 3y’ + 16 = 0
d. 5x’ + 4y’ + 16 = 0 *
e. 5x’ – 4y’ – 16 = 0
f. 6x’ + 6y’ – 16 = 0
5(x+1) + 4(y+2) + 3 = 0
5x + 5 + 4y + 8 + 3 = 0
5x’ + 4y’ + 16 = 0
ME 601
Differential Calculus
16. A body moves such that its acceleration as a function of time is a=2+12t, where “a” is in m/s2. If
its velocity after 1 s is 11 m/s. find the distance traveled after 5 seconds.
a. 256 m
b. 340 m
c. 290 m *
d. 420 m
Dv/dt = (2 + 12t)dt
Dv = 2t + 6t2 + C
@t = 1 min = 60 sec
C = 3 m/sec
After 5 sec
V = 2t + 6t2 + C @t = 5 sec
17. A runner and his coach are standing together on a circular track of radius 100 meters. When the
coach gives a signal, the runner starts to run around the track at a speed of 10 m/s. How fast is
the distance between the runners has run ¼ of the way around the track?
a. 5.04 m/s
b. 6.78 m/s
c. 5.67 m/s
d. 7.07 m/s *
Rate = 10 m /sec
Notes: Simplify writing LN, use rad for transcendental (sin.cos.tan), mathio. Utilized shiftstore if
necessary. Use answer to divide whentesting answers (Ans should be = 1)
-tan(0.3) = -0.309
Integral Calculus
c. (1/2)(3t – 1)^5/2 + c
d. (1/2)(3t – 1)^3/2 + c
Sqrt(3x-1) CALC @x = 1.1
SHIFTSTO-> A (1.5165)
SHIFT(Integ) d/dx (2/9 * (3t-1)^3/2) @x = 1.1
Ans/A = 1
@X = 1.1
SHIFTSTO-> A (12.167)
SHIFT(Integ)d/dx((1/12)(3x-1)4) @x = 1.1
Ans/A = 1
24. Find the area of the region above the x axis bounded by the curve y = -x2 + 4x – 3.
25. Find the volume of the solid of revolution formed by rotating the region bounded by the
parabola y = x2 and the lines y = 0 and x = 2 about the x axis.
Differential Equations
26. Find the differential equation of the family of line passing through the origin.
A. xdy – ydx = 0 C. xdy + ydx = 0 *
B. ydy + xdx = 0 D. xdx + dy = 0
ME 601
Differentiate:
xdy - ydx = 0
27. The rate of population growth of a country is proportional to the number of inhabitants. If the
population of a certain country now is 40 million and 50 million in 10 years’ time, what will be its
population 20 years from now?
A. 62.5 million* C. 56.20 million
B. 65.20 million D. 52.6 million
20 50
28. What is the equation (DE) of the family of parabolas having their vertices at the origin and their
foci n the x – axis.
A.2xdy – ydx = 0* C. xdy – 2y2dx = 0
B. 2ydy + x dx
2
D. y dy + 2xydx = 0
2
29. Determine the degree of the given ordinary D.E y’’’’ – 4(y’’’)² + 3(y’’)³ - y’ = 0
a. 1* c. 3
b. 2 d. 4
30. A thermometer reading 18 deg F is brought into a room where the temperature is 70 deg F; a
minute later, the thermometer reading is 31 deg F. determine the temperature reading 5
minutes after the thermometer is first brought into the room.
A. 57.68 deg F* C. 30.01 deg F
B. 42.4 deg F D. 53.89 deg F
Constant at 70
1 70-31
31. The probability that both stages of a two-stage rocket to function correctly is 0.92. The reliability
of the first stage is 0.97. The reliability of the second stage is:
a. 0.948 *
b. 0.958
c. 0.968
d. 0.8924
Event A = 0.97
0.92/0.97 = 0.948
32. Ricky and George each throw dice. If Ricky gets a sum of four what is the probability that George
will get less than of four?
a. ½
b. 5/6
c. 9/11
d. 1/12 *
33. Two fair dice are thrown. What is the probability that the sum of the dice is divisible by 5?
a. 7/36 *
b. 1/9
c. 1/12
d. ¼
Divisible by 5; 5, 10
7/36
ME 601
34. An um contains 4 black balls and 6 white balls. What is the probability of getting one black ball
and white ball in two consecutive draws from the urn?
a. 0.24
b. 0.27
c. 0.53 *
d. 0.04
B=4 W = 6 Total = 10
Two case will happen, Getting Black ball then white OR(+) Getting white, then black.
35. Five fair coins were tossed simultaneously. What is the probability of getting three heads and
two tails?
a. 1/32 *
b. 1/16
c. 1/8
d. ¼
1 of 2 outputs
(1/2)(1/2)(1/2)(1/2)(1/2) = 1/32
Physics
38. 38. A bullet is fired from a gun at an angle of 400. What is the range if its velocity is 300 m/s? g =
10 m/s.
A. 192.9m C. 8863 m*
B. 229.8 m D. 12000 m
39. A car accelerates from rest at 2 m/s² for 5 seconds, travels at constant speed for 10 seconds and
decelerates to rest at 2 m/s². Calculate the distance traveled by the car.
a. 525 m c. 450 m
b. 315 m d. 150 m*
V = Vo + accel*time = 0 + (2 m/sec2)*(5 sec) = 10 m/sec (THIS IS THE SPEED Gained from rest for 5 sec)
(0-10m/sec)/time = 2 m /sec2
Time = 5 seconds.
40. Two mass collide on a frictionless horizontal floor and perfectly inelastic collision. Mass 1 is 4
times Mass 2; velocity of mass 1 is 10 m/s to the right while mass 2 is 20 m/s to the left. What is
the velocity and direction of the resulting combined mass?
a. 10 m/s to the right c. 4 m/s to the right*
b. 10 m/s to the left d. 1.5 m/s to the left
P1 + P2 = 0 Condition M1 = 4M2
ME 601
-20m/sec(M2)/5(M2) = v’
Mechanics
41. A body weighing 40lb starts from rest and slides down a plane at an angle of 30deg with the
horizontal for which the coefficient of friction u = 0.30. How far will it move during the third
second?
a. 19.63 feet
b. 19.33 feet *
c. 18.33 feet
d. 19.99 feet
A = 7.734 ft/sec2
Vf = Vo + a*t
Vf = at rest (0) + 7.734 ft/sec2*(2 sec) = 15.468 ft/sec (NOTE: 2 sec is the change of time from rest and
started sliding down)
Distance = V*t + ½ a*t2 = 15.468 * 1 + ½(7.734)(1sec)2 = 19.33 ft (we used 1 sec, as with the reference
that is was able to move 2 sec from rest, then the third sec is with the current speed and acceleration)
ME 601
42. A pick-up truck is traveling forward at 25m/s. The bed is loaded with boxes whose coefficient of
friction with the bed is 0.4. What is the shortest time that the truck can be brought to a stop
such that the boxes do not shift?
a. 2.35s
b. 4.75s
c. 5.45s
d. 6.37s *
F = REVERSE FORCE
V = Vo - a*time
0 = 25 - 3.924*t
43. Two cars A and B accelerate from a stationary start. The acceleration of A is 4 ft/sec^2 and that
of B is 5 ft/sec^2. If B was originally 20 feet behind A , how long will it take B to overtake A.
a. 18.6 sec
b. 10 sec
c. 12.5 sec
d. 6.32 sec *
Distance A = Sa; Sa = Vo*t + ½ 4ft/sec2 * (t)2
Distance B = Sb; Sb = Vo*t + ½ 5ft/ sec2 * (t)2
Condition: Sb = Sa + 20 feet (condition of B overtaking A)
Relative to time (Distance = V*t + ½ accel * time2)
44. Two cars, A and B, are travelling at the same speed of 80 km/hr in the same direction on a level
road, with car A 100 meters ahead of car B. Car A slows down to make a turn decelerating at 7
ft/sec^2. In how many seconds will B overtake A.
a. 6.96 sec
b. 5.55 sec
c. 7.85 sec
d. 9.69 sec *
ME 601
45. What is the magnitude of the resultant force of the two forces 200N at 20deg and 400N at
144deg?
a. 332.5N*
b. 323.5N
c. 313.5N
d. 233.5N
46. A load of 100 lb is hung from the middle of the rope, which is stretched between two rigid walls
30ft. apart. Due to the load, the rope sags 4 feet in the middle. Determine the tension in the
rope.
a. 165lbs.
b. 173lbs.
c. 194lbs. *
d. 149lbs.
47. A 100kg weight rest on a 30degrees incline plane. Neglecting friction, how much pull must one
exert to bring the weight up the plane?
a. 88.67kg.
b. 100kg
c. 70.71kg
d. 50kg *
48. A block weighing 500kN rest on a ramp inclined at 25degrees with the horizontal. The force
tending to move the block down the ramp is ________.
a. 121kN
b. 265kN
c. 211kN *
d. 450kN
49. A 200kg crate impends to slide down a ramp inclined at an angle of 19.29deg with the horizontal.
What is the frictional resistance?
a. 612.38N
b. 628.38N
c. 648.16N *
d. 654.12N
50. A man can exert a maximum pull of 1000N but wishes to lift a new stone door for his cave
weighing 20,000N. If he uses a lever, how much closer must the fulcrum be to the stone then to
his hand?
a. 10 times nearer
b. 20 times farther
c. 10 times farther
d. 20 times nearer *
20kN * x2 = 1kN * x1
20 x2 = x1 x1 which is the force the man can exert, should have the fulcrum 20 times nearer to 20kN
ME 601
Engineering Economy
51. A man is expecting to receive P450,000.00 at the end of 7 years. If money is worth 14%
compounded quarterly, how much is it worth at present?
e. P125,458.36
f. P147,456.36
g. P162,455.63
h. P171,744.44 *
52. A man has a will of P650,000.00 from his father. If his father deposited an account of
P450,000.00 in a trust fund earning 8% compounded annually, after how many years will the
man receive his will?
b. 4.55 years
c. 4.77 years *
d. 5.11 years
e. 5.33 years
Hint*: Backdoor and check the closest answer. In this case 4.77 years
53. Mr. Adam deposited P120,000.00 in a bank who offers 8% interest compounded quarterly. If the
interest is subject to a 14% tax, how much will he receive after 5 years?
a. P178,313.69
b. P153,349.77
c. P170,149.77 *
d. P175,343.77
P = 120000
54. What interest compounded monthly is equivalent to an interest rate of 14% compounded
quarterly?
a. 1.15%
b. 13.84% *
c. 10.03%
d. 11.52%
Interest = P*rate/period
This will take long to compute when using calc. Use BackDOOR!
Ans: 13.84 %
55. What is the present worth of two P100.00 payments at the end of the third and the fourth year?
The annual interest rate is 8%.
a. P152.87 *
b. P112.34
c. P187.98
d. P176.67
Problem indicates regular payments stated as two 100.00 payments, hinting annuity.
Ptotal = 153
56. What amount would have to be invested at the end of each year for the next 9 years at 4%
compounded semi-annually in order to have P5,000.00 at the end of the time?
a. P541.86 *
b. P553.82
c. P542.64
d. P548.23
Principle =
ME 601
57. A contractor bought a concrete mixer at P120,000.00 if paid in cash. The mixer may also be
purchased by installment to be paid within 5 years. If money is worth 8%, the amount of each
annual payment, if all payments are made at the beginning of each year, is:
a. P27,829.00 *
b. P29,568.00
c. P31,005.00
d. P32,555.00
58. A contract calls for semiannual payments of P40,000.00 for the next 10 years and an additional
payment of P250,000.00 at the end of that time. Find the equivalent cash value of the contract
at 7% compounded semiannually?
a. P444,526.25
b. P598,589.00
c. P694,138.00 *
d. P752,777.00
59. A man is left with an inheritance from his father. He has an option to receive P2 M at the end of
10 years; however he wishes to receive the money at the end of each year for 5 years. If interest
rate is 8%, how much would he receive every year?
a. P400,000.00
b. P352,533.00
c. P232,020.00 *
d. P200,000.00
60. How much money must you deposit today to an account earning 12% so that you can withdraw P25,000 yearly indefinitely starting
at the end of the 10th year?
a. P125,000
b. P89,456
c. P73,767
d. P75,127 *
Fluid Mechanics:
61. Water, density = 62.4 lbf/ft3, is flowing through a pipe. A pitot static gage registers 3.0 inches of
mercury. What is the velocity of water in the pipe? Note: densityhg = 848.6 lbf/ft3.
62. A cylindrical 1 ft diameter tank, 4 ft high contains 3 ft of water. What rotational speed is required to
spin the water out the top?
ME 601
㌳䁣
ω= = sqrt((2*32.2*4ft/0.5ft)) = 22.698 rad/sec = 22.7 rad/sec
63. A 1 m x 1.5 m cylindrical tank is full of oil with SG = 0.92. Find the force acting at the
bottom of the tank in dynes.
Pressure = Gamma * Height = (S.G*density water)*Height = 0.92 * 9.81 KN/m3 * 1.5 m = 13.5378 kPA
Force = Pressure * Area = 13.5378 * (pi/4 * (1m)2 *) = 10.632 kN = 10632 N = 106.32 * 106 dynes
Note: 1N = 100 000 dynes : Force has Newton unit; Pressure in Pascal
64. Find the pressure at the 100 fathom depth of water in kPag.
A. 1,793.96 kPag*
B. 1,893.96 kPag
ME 601
C. 1,983.96 kPag
D. 1,693.96 kPag
65. A large mining company was provided with a 3 m3 of compressed air tank. Air pressure in the tank
drops from 700 kPa to 150 kPa while the temperature remains constant at 28oC. What percentage has
the mass of air in the tank been reduced?
A. 74.00
B. 72.45
C. 78.56
D. 78.57 *
Fluid mach
Thermodynamics 1:
66. Air is compressed adiabatically from 30oC to 100oC. If mass of air being compressed is 5 kg. Find the
change in entropy.
A. 1.039 kJ/kg
B. 0.746 kJ/kg
C. 0 *
D. 1.245 kJ/kg
67. A perfect gas has a value of R = 58.8 ft-lb/lb-oR and k = 1.26. if 20 BTU are added to 10 lbs of the gas
at constant volume when initial temperature is 90o F. Find the final temperature.
A. 97oF *
B. 104oF
C. 154oF
D. 185oF
ME 601
68. Air enters a nozzle steadily at 1.71 kg/m3 and 35 m/s. what is the mass flow rate through the nozzle
if the inlet area of the nozzle is 80 cm2?
69. A carnot cycle has a maximum temperature of 580F and minimum temperature of 150F. if the heat
added is 4200 BTU/min, find the horsepower output of the engine.
Recall Efficiency of Carnot = (THIGH – TLOW)/THIGH = (580 – 150)RANKINE/ (580 + 460RANKINE) = 0.4134
70. Steam turbine is receiving 1000 lbm/hr of steam, determine the horsepower output of the turbine if
the work done by steam is 250 Btu/lbm.
Thermodynamics 2:
71. Determine th air – standard efficiency of an engine operating on the diesel cycle with clearance of
6% when the suction pressure is 99.97 kPa and the fuel is injected for 7% of the stroke. Assume k = 1.4
A. 62.11% *
B. 51.20%
C. 73.58%
D. 60.02%
Then
72. A 2000 kW Diesel engine unit uses 1 bbl oil per 525 kWh produced. Oil is 25°API. Efficiency of
generator 93%, mechanical efficiency of engine 80%. What is the thermal of engine based on indicated
power (%)?
73. An air-standard Brayton cycle has a pressure ratio of 8. The air properties at the start of compression
are 100 kPa and 25°C. The maximum allowable temperature is 1100°C. Determine the net work.
When referring to Pressure Ratio, (take note of HI/LOW: Phigh/Plow, BRAYTON CYCLE is SPSP)
PHIGH/PLOW = 8
PLOW = 100 kPa
ME 601
74. Steam leaves an industrial boiler at 827.4 kPa and 171.6C. A portion of the steam is passed through a
throttling calorimeter and is exhausted to the atmosphere when the calorimeter pressure is 101.4 kPa.
How much moisture does the steam leaving the boiler contain if the temperature of the steam at the
calorimeter is 115.6C?
75. A turbine has an available enthalpy of 3300 kJ/kg in a Rankine cycle. The pump work has also 25
kJ/kg. For flow of 3 kg/s, find the system output.
Note the cycle (Rankine – common to steam pplant ). Recall: System Output = mass flowrate * (Change
in Enthalpy) = 3 kg/sec (3300kj/kg – 25 kj/kg) = 9825 kW
This is Work is the ideal Rankine cycle. (Pump – Turbine)
Heat Transfer:
ME 601
A. 23.56 watts
B. 32.77 watts*
C. 9.22 watts
D. 43.45 watts
Recall: Radiation Heat Xfer = SEAT4
Qconv = 5.89
Qrad = 5.7 * 10-8 * 0.8 * 4 * pi * (0.05/2)2 ((20+273)4 – (70+273)4) = 2.3
77. For heat transfer purposes, a standing man can be modeled as a 30 cm diameter, 170 cm long
vertical cylinder with bottom both the top and bottom surfaces insulated and with the side surface at an
average temperature of 34 deg C. For a convection heat transfer coefficient is 15 W/m2-C, determine
the rate of the heat loss from this man by convection in an environment at 20 deg C.
Recall: Convective Heat xfer. Q = hA(dT) = 15 W/m2 . °C * pi * 0.3 m * 1.7 m * (34-20)°C = 336.46
78. Consider a person standing in a breezy room at 20 deg C. Determine the total rate transfer from this
person of the exposed surface area and the average outer surface temperature of the person are 1.6m2
and 29 deg C, respectively, and the convection heat transfer coefficient is 6 W/m2 with emissivity of 0.95.
Two Modes of Heat Transfer is occuring, as per stated in the problem. Convective and Radiative Heat
Transfer. Then Total Heat Transfer = Qconv + Qrad = HAdT + SEAT4
Qrad = 5.7 * 10-8 (0.95) * (1.6m2) * ((29+273)4 – (20 + 273)4) = 81.7184 Watts
79. A tank contains liquid nitrogen at -190 c0 is suspected in a vacuum shell by three stainless steel rods
0.80 cm in diameter and 3 meters long with a thermal conductivity of 16.3 W/m2-C0. If the ambient air
outside the vacuum shell is 15 C0, calculate the magnitude of the conductive heat flow in watts along
the support rods.
ME 601
A. 0.168 *
B. 0.176
C. 0.182
D. 0.0587
Problem States, determine CONDUCTIVE HEAT FLOW. Recall Heat Conduction = HA(dT)
Then, Q = 16.3 W/m2 – C * (pi/4 * (0.008 m)2) * (15 – (-190)) = 0.167 Watts
80. How many watts will be radiated from a spherical black body 15 cm in diameter at a temperature of
800 degC?
A. 5.34 KW*
B. 4.34 KW
C. 6.34 KW
D. 3.34 KW
Combustion:
Determine the air – fuel ratio for complete combustion on molar basis.
A. 2.130
B. 3.230
C. 1.233*
D. 1.130
Compute first the Oxygen Chemical Reaction (as this pertains to the product after reacting to Fuel)
Less the 0.6%O2 from fuel = 0.265 – 0.006 = 0.259 O2 from air only.
***RECALL: the 3.76 is the mole of NITROGEN, from 79%/21% composition of oxygen
A. 2.870
B. 7.526 *
C. 2.274
D. 6.233
From Problem, coal stated as fuel (solid fuel). Known ultimate analysis (percentage of each elements),
therefore use EMPERICAL FORMULA for COMBUSTION OF SOLID FUELS
%Mass of N2 = 76.8% * Mass of of Air, in this case = 0.768 * 10.378 = 7.97 lb/lb. (Nearest ans 7.526)
83. A diesel power plant uses fuel with heating vlue of 43,000 kJ/kg. What is the density of the fuel at
25C?
API = 13.395
84. The heating value of fuel supplied in a boiler is 43,000 kJ/kg. If the factor of evaporation is 1.10 and
the actual specific evaporation is 10, what is the efficiency of the boiler?
FE = (HSTEAM – HFUEL)/2257
ASE = MSTEAM/MFUEL
Simplify:
SG15C = 0.892
Density = Mass/Volume
ME 601
ME Laws:
A. RA 8459 * C. RA 5984
B. RA 3449 D. RA 6561
D. CONCLUSION
B. Penalties
C. Transitory Provisions
D. Funding Provisions
90. According to Sec 42, t any person who violates any of the provisions of this Act and its rules and
regulations shall, upon conviction be penalized by a fine of not less than
AC/DC
ME 601
91. An ideal step-up transformer with 100 turns in the primary and 2500 turns in the secondary carries a
load of 2A in the secondary windings. What is the current in the primary side?
A. 50A * C. 25A
B. 0.08A D. 1,250A
Turn Ratio:
100/2500 = 1/25 = 0.04
Primary Turn/Secondary Turn = Current Secondary/Current Primary
0.04 = 2Amp/Current Primary
Current Primary = 2/0.04 = 50A
A. 0 V C. 60 V *
B. 36 V D. 240 V
V1/V2 = N1/N2
120V/V2 = 2
V2 = 120/2 = 60V
94.A transformer has a turns ratio of 4: 1. What is the peak secondary voltage if 115 V rms is applied to
the primary winding?
A. 40.7 V * C. 163 V
B. 64.6 V D. 650 V
V1/V2 = 4/1
Vrms = Vpeak/sqrt(2)
162.6345/V2 = 4/1
ME 601
95.Line voltage may be from 105 V rms to 125 rms in a half-wave rectifier. With a 5:1 step-down
transformer, the maximum peak load voltage of an ideal approximation is closest to
A. 21 V C. 29.6 V
B. 25 V D. 35.4 V *
Basic Electronics:
97. If N1/N2 = 2, and the primary voltage is 120 V, what is the secondary voltage?
A. 0 V
B. 36 V
C. 60 V *
D. 240 V
V1/V2 = N1/N2
120V/V2 = 2
V2 = 120/2 = 60V
98.A transformer has a turns ratio of 4: 1. What is the peak secondary voltage if 115 V rms is applied to
the primary winding?
A. 40.7 V *
B. 64.6 V
ME 601
C. 163 V
D. 650 V
V1/V2 = 4/1
Vrms = Vpeak/sqrt(2)
162.6345/V2 = 4/1
V2 or V secondary = 162.6345/4 = 40.6586 = 40.7V
99.Line voltage may be from 105 V rms to 125 rms in a half-wave rectifier. With a 5:1 step-down
transformer, the maximum peak load voltage of an ideal approximation is closest to
A. 21 V
B 25 V
C. 29.6 V
D. 35.4 V*
100.What is the peak load voltage out of a bridge rectifier for a secondary voltage of 15 V rms? (Use
second approximation.)
A. 9.2 V
B. 15 V
C. 19.8 V *
D. 24.3 V
Approximate computation:
15V = Vpeaksecondary / sqrt(2)
Vpeak Secondary = 21.21
Using second approximation: Diode is silicon with 0.7 voltage drop that doubles, considering it’s a full
bridge (4 diodes)
NOTES:
Boilers and Steam Power Plants Relates to QH process (API and HHV)
CALTECH(Prtl Der)
f(x,y) = eqn
**Shift(Integ) d/dx(eqn) @x = x
Autosub/A
Ans STO->A
Algebra:
X=-6, x=9, x = 2
(X+6)(X-9)(X-2)=0 A
2. Solve for x: Ax – B = Cx + D
A. (D + B) / (A – C) * C. (A – B) / (C + D)
B. (D + B) / (A + C) D. (D – B) / (A – C)
Transpose: Ax – Cx = D + B; x (A – C) = D + B ; x = (D + B)/(A – C)
3. An airplane flies 1,120km with a tail wind and returns, flying into the same wind. The total flying
time is 3 hrs and 45 minutes, and the airplanes airspeed is 600 kph. What is the wind speed
A. 10 C. 20
B. 30 D. 40*
Recall:
5. Given f(x)= (x – 1)/(x3 – 3x2 + 2x), find x when the value of f(x) is undefined.
A. 0, -1 and -2 C. 0 and 2
B. 0, 1 and 2 * D. 1 and 2
Trigonometry:
6. If th h t th , then find A + B.
A. 1* B. 7 C. 5 D. 6
7. Find the radius of a circle of a circle of a sector in it with an angle of 1.2 radians has a perimeter of 48
cm.
A. 17 cm B. 16 cm C. 15 cm* D. 14 cm
8. The angle of inclination of ascend of a road having 8.25% grade is ____ degrees?
A. 4.72 * C. 5.12
B. 4.27 D. 1.86
Theta = 4.7162°
ME 601
9. An observer wishes to determine the height of a tower. He takes sight at the top of the tower from A
and B, which are 50 ft apart at the same elevation on a direct line with the tower. The vertical angle at a
point A is 30o and at point B is 40o. What is the height of the tower?
A. 85.60 ft C. 110.29 ft
tan40° = h/x
x = h/tan40°
tan30° = h/50 + x
x = h/tan30° - 50
1 to 2
h/tan40° = h/tan30° - 50
1.19175h = 1.73205h - 50
h = 92.54 ft
10. A, B and C are points on a circle. AC bisects the circle and AB = BC. The area of triangle ABC is most
clearly what percent of the circles area?
A. 44 C. 36
B. 32* D. 24
11. The sum of the coefficient of x and y in Ax + By – 16 = 0 is 14. If the slope of the line is 8, find A and B.
A + B = 14
12. Find the focus of the hyperbola 16y2 – 9x2 + 36x + 96y – 36 = 0.
A. 40o C. 45o *
B. 60o D. 30o
A. 60 C. 120
B. 80 D. 90 *
Differential Calculus:
16. The point on the curve where the second derivative of the function is zero.
A. 10 x 10 x 15 mm C. 30 x 30 x 17 mm
B. 20 x 20 x 16 mm* D. 5 x 5 x 14 mm
h h t
A. h
* B. t t
C. h
D. t
19. A balloon leaving the ground 18 from the observer rises 3 m/s. how fast is the angle of elevation of
line of sight increasing after 8 seconds.
A. 0 C. 1*
B. ½ D. 2
Integral Calculus:
21. Determine the area bounded by y = x2 – 4, the x – axis and the lines x = -1, x = 1.
22. A hole of the radius 4 is bored through the center of a sphere of radius 5. Find the volume of the
remaining portion of the sphere.
A. 28 pi C. 36 pi*
B. 30 pi D. 29 pi
th
23. Evaluate
B. cos + C D. -cos√x + C
24. The integral of sin2 Ɵ dƟ from 0 to pi/2 is:
A. pi/2 C. ½
B. pi/4 * D. ¼
25. Find the volume (in cubic units) generated by rotating a circle x² + y² + 6x + 4y + 12 = 0 about the y-
axis
A. 39.48 C.59.22*
B. 47.23 D. 50.1
Differential Equations:
26. Find the differential equation of the family of line passing through the origin.
Differentiate:
ME 601
xdy - ydx = 0
27. The rate of population growth of a country is proportional to the number of inhabitants. If the
population of a certain country now is 40 million and 50 million in 10 years’ time, what will be its
population 20 years from now?
20 50
28. What is the equation (DE) of the family of parabolas having their vertices at the origin and their foci
n the x – axis.
29. Determine the degree of the given ordinary D.E y’’’’ – 4(y’’’)² + 3(y’’)³ - y’ = 0
A. 1* C. 3
B. 2 D. 4
ME 601
30. A thermometer reading 18 deg F is brought into a room where the temperature is 70 deg F; a minute
later, the thermometer reading is 31 deg F. determine the temperature reading 5 minutes after the
thermometer is first brought into the room.
1 70-31
31. In a ME 600 final examination, the probability that the examinee will pass each of the three subjects
is 0.60. what is the probability that the examinee will pass at most three subjects?
A. 0.064 C. 0.784
B. 0.216 * D. 0.936
32. In a single throw of a pair of ice, what is the probability of having a sum of 7 or 11?
A. 2/9 * C. 1/6
B. 7/36 D. 1/3
A. 2* C. 8
B. 13 D. 18
34. A bag contains 4 white, 3 blacks ball and another bag contains 3 white and 5 black balls. One ball is
drawn from the first bag and placed unseen in the second bag. What is the probability that a ball now
drawn from the second bag is black?
A. 38/63* C. 24/63
B. 35/63 D. 45/63
35. Given a set 25 elements with = 75 and = 350, find the standard deviation.
A. 5.12 C. 3
ME 601
B. 5 D. 2.24*
Physics:
37. Going against a wind, a domestic plane can travel 5/8 of the distance in one hour that it is going with
the wind. If the plane can fly 300mph in calm wind, what is the velocity of the wind?
38. A bullet is fired from a gun at an angle of 400. What is the range if its velocity is 300 m/s? g = 10 m/s.
A. 192.9m C. 8863 m*
B. 229.8 m D. 12000 m
39. A car accelerates from rest at 2 m/s² for 5 seconds, travels at constant speed for 10 seconds and
decelerates to rest at 2 m/s². Calculate the distance traveled by the car.
A. 525 m C. 450 m
B. 315 m D. 150 m*
From Rest to Accel @ 5 sec
ME 601
V = Vo + accel*time = 0 + (2 m/sec2)*(5 sec) = 10 m/sec (THIS IS THE SPEED Gained from rest for 5 sec)
(0-10m/sec)/time = 2 m /sec2
Time = 5 seconds.
40. Two mass collide on a frictionless horizontal floor and perfectly inelastic collision. Mass 1 is 4 times
Mass 2; velocity of mass 1 is 10 m/s to the right while mass 2 is 20 m/s to the left. What is the velocity
and direction of the resulting combined mass?
P1 + P2 = 0 Condition M1 = 4M2
-20m/sec(M2)/5(M2) = v’
Mechanics:
ME 601
41. A cable weighing 150 N/m has a span of 150 m and a sag of 36 m. determine the maximum tension
in the cable.
43. The valve push rod for an overhead valve engine is ¼ inch in diameter and 14 inches long. Find the
diameter and inertia of the rod in inches.
44. A test specimen is under tension. The load is 20, 000 lb., allowable stress is 10, 00 0 psi, modulus of
elasticity is 30 million psi, and original length of specimen is 40 in. what is the required cross section, in
sq inches, if the resulting elongation must not be greater than 0.001 inch?
A. 2 C. 26.6*
B. 10 D. 62.2
45. A circular aluminum tube of length L=400mm is loaded in compression by forces P as shown in the
figure. The outside and inside diameters are 60 mm and 50 mm, respectively. If the compressive stress
in the bar is intended to be 40 MPa, what should be the load P?
46. A motorist drives north for 35.0 minutes at 85.0 km/hr and then stops for 15.0 minutes. He then
continues north, traveling 130 km in 2.00 hours. What is his average velocity?
47. An arrow is shot straight up in the air at an initial speed of 15.0 m/s. After how much time is the
arrow heading downward at a speed of 8.00 m/s?
ME 601
48. Determine the bursting steam pressure of a steel shell with diameter of 10 inches and made of ¼
thick steel plate. The joint efficiency is at 70% and the tensile strength is 60 ksi
49. A drop hammer of 1 ton dead weight capacity is propelled downward by a 12 inch diameter cylinder.
At 100 psi air pressure what is the impact velocity if the stroke is 28 inches?
50. Which of the following is the type of stress that differs from compressive stress and it is caused by a
contact pressure between separate bodies.
Engineering Economy:
51. A company needs P60, 000 in five years to buy a new equipment in order to accumulate this sum, a
sinking fund consisting of three annual payments is established now. For tax purposes, no further
payments will be made after three years. What payments are necessary if money is worth 18% per
annum?
52. A man borrowed the amount of P20,000 with an interest of 30%. How much is the interest is he
going to pay at the end of 22 months?
53. What is the present worth of a $100 annuity starting at the end of the third year and continuing to
the end of the fourth year, if the annual interest rate is 8%?
A. $122* C. $160
B. $153 D. $162
54. An item is purchased for P5,000,000 annual cost are P900,000. Using 8%, what is the capitalized cost
of perpetual service?
A. P16,250,000.00* C. P16,890,000.00
ME 601
B. P18,345,243.00 D. P17,435,000.00
55. You borrowed the amount of P10, 000 in a bank with an interest rate of 30% compounded monthly.
How much would you have to pay after 2 years?
56. A man invests 10,000 today to be repaid in 5 years in 1 lump sum at 12 % compounded annually. If
the rate of inflation is 3 % compounded annually, how much profit in present day pesos, is realized over
the five years?
A. P320 C. P5202*
B. P5628 D. P 7623
57. An investment of x dollar is made at the end of each year for three years, at an interest rate of 9%
per year compounded annually. What will the dollar value of the total investment be upon the deposit
of the third payment?
A. 0.727x C. 3.278x*
B. 1.295x D. 3x
58. A mining company invested 25,000,000 to develop an oil well which is estimated to contain
1,000,000 barrels of oil. During a certain year, 200,000 barrels were produced from this well. Compute
the depletion charge during the year.
A. 10M C. 8M
B. 5M* D. 1M
60. A machine has a first cost of ₱60,000 and has an expected salvage value after 10 years of ₱6,000.
Find the book value after 5 years using declining balance method.
Fluid Mechanics:
61. Water, density = 62.4 lbf/ft3, is flowing through a pipe. A pitot static gage registers 3.0 inches of
mercury. What is the velocity of water in the pipe? Note: densityhg = 848.6 lbf/ft3.
62. A cylindrical 1 ft diameter tank, 4 ft high contains 3 ft of water. What rotational speed is required to
spin the water out the top?
㌳䁣
ω= = sqrt((2*32.2*4ft/0.5ft)) = 22.698 rad/sec = 22.7 rad/sec
63. A 1 m x 1.5 m cylindrical tank is full of oil with SG = 0.92. Find the force acting at the
bottom of the tank in dynes.
Pressure = Gamma * Height = (S.G*density water)*Height = 0.92 * 9.81 KN/m3 * 1.5 m = 13.5378 kPA
Force = Pressure * Area = 13.5378 * (pi/4 * (1m)2 *) = 10.632 kN = 10632 N = 106.32 * 106 dynes
Note: 1N = 100 000 dynes : Force has Newton unit; Pressure in Pascal
ME 601
64. Find the pressure at the 100 fathom depth of water in kPag.
E. 1,793.96 kPag*
F. 1,893.96 kPag
G. 1,983.96 kPag
H. 1,693.96 kPag
65. A large mining company was provided with a 3 m3 of compressed air tank. Air pressure in the tank
drops from 700 kPa to 150 kPa while the temperature remains constant at 28oC. What percentage has
the mass of air in the tank been reduced?
E. 74.00
F. 72.45
G. 78.56
H. 78.57 *
Fluid mach
Thermodynamics 1:
66. Air is compressed adiabatically from 30oC to 100oC. If mass of air being compressed is 5 kg. Find the
change in entropy.
E. 1.039 kJ/kg
F. 0.746 kJ/kg
G. 0 *
H. 1.245 kJ/kg
67. A perfect gas has a value of R = 58.8 ft-lb/lb-oR and k = 1.26. if 20 BTU are added to 10 lbs of the gas
at constant volume when initial temperature is 90o F. Find the final temperature.
E. 97oF *
F. 104oF
G. 154oF
H. 185oF
68. Air enters a nozzle steadily at 1.71 kg/m3 and 35 m/s. what is the mass flow rate through the nozzle
if the inlet area of the nozzle is 80 cm2?
69. A carnot cycle has a maximum temperature of 580F and minimum temperature of 150F. if the heat
added is 4200 BTU/min, find the horsepower output of the engine.
Recall Efficiency of Carnot = (THIGH – TLOW)/THIGH = (580 – 150)RANKINE/ (580 + 460RANKINE) = 0.4134
70. Steam turbine is receiving 1000 lbm/hr of steam, determine the horsepower output of the turbine if
the work done by steam is 250 Btu/lbm.
Thermodynamics 2:
71. Determine th air – standard efficiency of an engine operating on the diesel cycle with clearance of
6% when the suction pressure is 99.97 kPa and the fuel is injected for 7% of the stroke. Assume k = 1.4
E. 62.11% *
F. 51.20%
G. 73.58%
H. 60.02%
Then
72. A 2000 kW Diesel engine unit uses 1 bbl oil per 525 kWh produced. Oil is 25°API. Efficiency of
generator 93%, mechanical efficiency of engine 80%. What is the thermal of engine based on indicated
power (%)?
73. An air-standard Brayton cycle has a pressure ratio of 8. The air properties at the start of compression
are 100 kPa and 25°C. The maximum allowable temperature is 1100°C. Determine the net work.
When referring to Pressure Ratio, (take note of HI/LOW: Phigh/Plow, BRAYTON CYCLE is SPSP)
PHIGH/PLOW = 8
PLOW = 100 kPa
PHIGH = 8 * 100 kPa = 800 kPa
Recall: Net Work = Work of Turbine – Work of Compressor
T1 = 25 C + 273 = 298K
T2 = ?
T2 = T1(PHIGH/PLOW)^(k-1/k) = 100(8)^(1.4-1/1.4) = 539.811K
Work of Compressor = mCpdT = 1(539.811-298) = 241.8113
74. Steam leaves an industrial boiler at 827.4 kPa and 171.6C. A portion of the steam is passed through a
throttling calorimeter and is exhausted to the atmosphere when the calorimeter pressure is 101.4 kPa.
How much moisture does the steam leaving the boiler contain if the temperature of the steam at the
calorimeter is 115.6C?
75. A turbine has an available enthalpy of 3300 kJ/kg in a Rankine cycle. The pump work has also 25
kJ/kg. For flow of 3 kg/s, find the system output.
Note the cycle (Rankine – common to steam pplant ). Recall: System Output = mass flowrate * (Change
in Enthalpy) = 3 kg/sec (3300kj/kg – 25 kj/kg) = 9825 kW
This is Work is the ideal Rankine cycle. (Pump – Turbine)
Heat Transfer:
A. 23.56 watts
B. 32.77 watts*
C. 9.22 watts
D. 43.45 watts
77. For heat transfer purposes, a standing man can be modeled as a 30 cm diameter, 170 cm long
vertical cylinder with bottom both the top and bottom surfaces insulated and with the side surface at an
average temperature of 34 deg C. For a convection heat transfer coefficient is 15 W/m2-C, determine
the rate of the heat loss from this man by convection in an environment at 20 deg C.
Recall: Convective Heat xfer. Q = hA(dT) = 15 W/m2 . °C * pi * 0.3 m * 1.7 m * (34-20)°C = 336.46
78. Consider a person standing in a breezy room at 20 deg C. Determine the total rate transfer from this
person of the exposed surface area and the average outer surface temperature of the person are 1.6m2
and 29 deg C, respectively, and the convection heat transfer coefficient is 6 W/m2 with emissivity of 0.95.
Two Modes of Heat Transfer is occuring, as per stated in the problem. Convective and Radiative Heat
Transfer. Then Total Heat Transfer = Qconv + Qrad = HAdT + SEAT4
Qrad = 5.7 * 10-8 (0.95) * (1.6m2) * ((29+273)4 – (20 + 273)4) = 81.7184 Watts
79. A tank contains liquid nitrogen at -190 c0 is suspected in a vacuum shell by three stainless steel rods
0.80 cm in diameter and 3 meters long with a thermal conductivity of 16.3 W/m2-C0. If the ambient air
outside the vacuum shell is 15 C0, calculate the magnitude of the conductive heat flow in watts along
the support rods.
A. 0.168 *
B. 0.176
C. 0.182
D. 0.0587
Problem States, determine CONDUCTIVE HEAT FLOW. Recall Heat Conduction = HA(dT)
Then, Q = 16.3 W/m2 – C * (pi/4 * (0.008 m)2) * (15 – (-190)) = 0.167 Watts
80. How many watts will be radiated from a spherical black body 15 cm in diameter at a temperature of
800 degC?
A. 5.34 KW*
B. 4.34 KW
C. 6.34 KW
D. 3.34 KW
Combustion:
Determine the air – fuel ratio for complete combustion on molar basis.
E. 2.130
F. 3.230
G. 1.233*
H. 1.130
Compute first the Oxygen Chemical Reaction (as this pertains to the product after reacting to Fuel)
Less the 0.6%O2 from fuel = 0.265 – 0.006 = 0.259 O2 from air only.
***RECALL: the 3.76 is the mole of NITROGEN, from 79%/21% composition of oxygen
E. 2.870
F. 7.526 *
G. 2.274
H. 6.233
From Problem, coal stated as fuel (solid fuel). Known ultimate analysis (percentage of each elements),
therefore use EMPERICAL FORMULA for COMBUSTION OF SOLID FUELS
%Mass of N2 = 76.8% * Mass of of Air, in this case = 0.768 * 10.378 = 7.97 lb/lb. (Nearest ans 7.526)
83. A diesel power plant uses fuel with heating vlue of 43,000 kJ/kg. What is the density of the fuel at
25C?
API = 13.395
84. The heating value of fuel supplied in a boiler is 43,000 kJ/kg. If the factor of evaporation is 1.10 and
the actual specific evaporation is 10, what is the efficiency of the boiler?
FE = (HSTEAM – HFUEL)/2257
ASE = MSTEAM/MFUEL
Simplify:
SG15C = 0.892
Density = Mass/Volume
ME Laws:
A. RA 8459 * C. RA 5984
B. RA 3449 D. RA 6561
D. CONCLUSION
B. Penalties
C. Transitory Provisions
D. Funding Provisions
ME 601
90. According to Sec 42, t any person who violates any of the provisions of this Act and its rules and
regulations shall, upon conviction be penalized by a fine of not less than
AC/DC
91. An ideal step-up transformer with 100 turns in the primary and 2500 turns in the secondary carries a
load of 2A in the secondary windings. What is the current in the primary side?
C. 50A * C. 25A
D. 0.08A D. 1,250A
Turn Ratio:
93. If N1/N2 = 2, and the primary voltage is 120 V, what is the secondary voltage?
ME 601
A. 0 V C. 60 V *
B. 36 V D. 240 V
V1/V2 = N1/N2
120V/V2 = 2
V2 = 120/2 = 60V
94.A transformer has a turns ratio of 4: 1. What is the peak secondary voltage if 115 V rms is applied to
the primary winding?
A. 40.7 V * C. 163 V
B. 64.6 V D. 650 V
V1/V2 = 4/1
Vrms = Vpeak/sqrt(2)
162.6345/V2 = 4/1
V2 or V secondary = 162.6345/4 = 40.6586 = 40.7V
95.Line voltage may be from 105 V rms to 125 rms in a half-wave rectifier. With a 5:1 step-down
transformer, the maximum peak load voltage of an ideal approximation is closest to
A. 21 V C. 29.6 V
B. 25 V D. 35.4 V *
Basic Electronics:
97. If N1/N2 = 2, and the primary voltage is 120 V, what is the secondary voltage?
A. 0 V
B. 36 V
C. 60 V *
D. 240 V
V1/V2 = N1/N2
120V/V2 = 2
V2 = 120/2 = 60V
98.A transformer has a turns ratio of 4: 1. What is the peak secondary voltage if 115 V rms is applied to
the primary winding?
A. 40.7 V *
B. 64.6 V
C. 163 V
D. 650 V
V1/V2 = 4/1
Vrms = Vpeak/sqrt(2)
162.6345/V2 = 4/1
V2 or V secondary = 162.6345/4 = 40.6586 = 40.7V
99.Line voltage may be from 105 V rms to 125 rms in a half-wave rectifier. With a 5:1 step-down
transformer, the maximum peak load voltage of an ideal approximation is closest to
A. 21 V
B 25 V
C. 29.6 V
D. 35.4 V*
V1/V2 = 5/1
176.77/5 = V2/1
V2 = 35.355 V =35.4 V
100.What is the peak load voltage out of a bridge rectifier for a secondary voltage of 15 V rms? (Use
second approximation.)
A. 9.2 V
B. 15 V
C. 19.8 V *
D. 24.3 V
Approximate computation:
15V = Vpeaksecondary / sqrt(2)
Vpeak Secondary = 21.21
Using second approximation: Diode is silicon with 0.7 voltage drop that doubles, considering it’s a full
bridge (4 diodes)